Item 6 of 6 (back to results) previous nordazepam "A 1,4-benzodiazepinone having phenyl and chloro substituents at positions 5 and 7 respectively; it has anticonvulsant, anxiolytic, muscle relaxant and sedative properties but is used primarily in the treatment of anxiety."

Current search: 03. Biological Effects of Specific Chemicals: biophysical uses [CHEBI:52208] × 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > central nervous system drug [CHEBI:35470] > psychotropic drug [CHEBI:35471] > tranquilizing drug [CHEBI:35473] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biophysical uses [CHEBI:52208] (136)   membrane transport modulator [CHEBI:38632] (122)   GABA modulator [CHEBI:50268] (9)   nordazepam [CHEBI:111762] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   central nervous system drug [CHEBI:35470] (217)   psychotropic drug [CHEBI:35471] (130)   tranquilizing drug [CHEBI:35473] (83)   anxiolytic drug [CHEBI:35474] (31)   nordazepam [CHEBI:111762] (1)  central nervous system depressant [CHEBI:35488] (90)   anticonvulsant [CHEBI:35623] (39)   nordazepam [CHEBI:111762] (1)  sedative [CHEBI:35717] (43)   nordazepam [CHEBI:111762] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   chlorine molecular entity [CHEBI:23117] (884)   organochlorine compound [CHEBI:36683] (543)   nordazepam [CHEBI:111762] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   nordazepam [CHEBI:111762] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   nordazepam [CHEBI:111762] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   nordazepam [CHEBI:111762] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   nordazepam [CHEBI:111762] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   nordazepam [CHEBI:111762] (1)  organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   nordazepam [CHEBI:111762] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   nordazepam [CHEBI:111762] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   nordazepam [CHEBI:111762] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   nordazepam [CHEBI:111762] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   nordazepam [CHEBI:111762] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   nordazepam [CHEBI:111762] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   nordazepam [CHEBI:111762] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   nordazepam [CHEBI:111762] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   nordazepam [CHEBI:111762] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   nordazepam [CHEBI:111762] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   nordazepam [CHEBI:111762] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   nordazepam [CHEBI:111762] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   nordazepam [CHEBI:111762] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   nordazepam [CHEBI:111762] (1) ChEBI Compound Accession Identifier:   [CHEBI:111762] ChEBI Compound Description:   "A 1,4-benzodiazepinone having phenyl and chloro substituents at positions 5 and 7 respectively; it has anticonvulsant, anxiolytic, muscle relaxant and sedative properties but is used primarily in the treatment of anxiety." ChEBI Compound Identification Number:   111762 ChEBI InChI Value:   InChI=1S/C15H11ClN2O/c16-11-6-7-13-12(8-11)15(17-9-14(19)18-13)10-4-2-1-3-5-10/h1-8H,9H2,(H,18,19) ChEBI InChIKey Value:   AKPLHCDWDRPJGD-UHFFFAOYSA-N ChEBI Compound Name:   nordazepam ChEBI SMILES Value:   Clc1ccc2NC(=O)CN=C(c3ccccc3)c2c1 ChEBI Substance ID:   87350503 ChEBI URL:   ChEBI:111762 ChemSpider ID:   2890 Ontomatica Chemical Accession Key (OnChAKey):   AKPLHCDWDRPJGD_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   2997