Item 6 of 7 (back to results) previous next XL765 A sulfonamide obtained by formal condensation of the sulfonic acid group of 4-[(3-methoxy-4-methylbenzoyl)amino]benzenesulfonic acid with the primary aromatic amino group of N-(3,5-dimethoxyphenyl)quinoxaline-2,3-diamine. A dual PI3K/mTOR inhibitor used in cancer treatment.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > enzyme inhibitor [CHEBI:23924] > lipid kinase inhibitor [CHEBI:50916] > phosphatidylinositol-3-OH kinase inhibitor [CHEBI:50914] × 05. Industrial Uses: pharmaceutical [CHEBI:52217] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   protein kinase inhibitor [CHEBI:37699] (69)   mTOR inhibitor [CHEBI:68481] (6)   XL765 [CHEBI:71958] (1)  lipid kinase inhibitor [CHEBI:50916] (16)   phosphatidylinositol-3-OH kinase inhibitor [CHEBI:50914] (16)   XL765 [CHEBI:71958] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   XL765 [CHEBI:71958] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   sulfonamide [CHEBI:35358] (106)   XL765 [CHEBI:71958] (1)  carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   XL765 [CHEBI:71958] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   XL765 [CHEBI:71958] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   XL765 [CHEBI:71958] (1)  organic amino compound [CHEBI:50047] (2472)   aromatic amine [CHEBI:33860] (91)   XL765 [CHEBI:71958] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   XL765 [CHEBI:71958] (1)  carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   XL765 [CHEBI:71958] (1)  sulfur molecular entity [CHEBI:26835] (1541)   sulfur oxoacid derivative [CHEBI:33424] (628)   sulfonic acid derivative [CHEBI:33552] (393)   sulfonamide [CHEBI:35358] (106)   XL765 [CHEBI:71958] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   XL765 [CHEBI:71958] (1)  carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   XL765 [CHEBI:71958] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   XL765 [CHEBI:71958] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   XL765 [CHEBI:71958] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   XL765 [CHEBI:71958] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   XL765 [CHEBI:71958] (1)  organic amino compound [CHEBI:50047] (2472)   aromatic amine [CHEBI:33860] (91)   XL765 [CHEBI:71958] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   XL765 [CHEBI:71958] (1)  carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   XL765 [CHEBI:71958] (1)  organic amino compound [CHEBI:50047] (2472)   aromatic amine [CHEBI:33860] (91)   XL765 [CHEBI:71958] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   XL765 [CHEBI:71958] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   XL765 [CHEBI:71958] (1)  organic aromatic compound [CHEBI:33659] (3593)   aromatic amine [CHEBI:33860] (91)   XL765 [CHEBI:71958] (1)  aromatic ether [CHEBI:35618] (353)   XL765 [CHEBI:71958] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   XL765 [CHEBI:71958] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   XL765 [CHEBI:71958] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   aromatic amine [CHEBI:33860] (91)   XL765 [CHEBI:71958] (1)  aromatic ether [CHEBI:35618] (353)   XL765 [CHEBI:71958] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   XL765 [CHEBI:71958] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   XL765 [CHEBI:71958] (1)  organic aromatic compound [CHEBI:33659] (3593)   aromatic amine [CHEBI:33860] (91)   XL765 [CHEBI:71958] (1)  aromatic ether [CHEBI:35618] (353)   XL765 [CHEBI:71958] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   XL765 [CHEBI:71958] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   XL765 [CHEBI:71958] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   XL765 [CHEBI:71958] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   XL765 [CHEBI:71958] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   XL765 [CHEBI:71958] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   naphthyridine derivative [CHEBI:73539] (11)   quinoxaline derivative [CHEBI:38771] (6)   XL765 [CHEBI:71958] (1)  organic aromatic compound [CHEBI:33659] (3593)   aromatic amine [CHEBI:33860] (91)   XL765 [CHEBI:71958] (1)  aromatic ether [CHEBI:35618] (353)   XL765 [CHEBI:71958] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   oxoacid derivative [CHEBI:33241] (3254)   sulfur oxoacid derivative [CHEBI:33424] (628)   sulfonic acid derivative [CHEBI:33552] (393)   sulfonamide [CHEBI:35358] (106)   XL765 [CHEBI:71958] (1) ChEBI Compound Accession Identifier:   [CHEBI:71958] ChEBI Compound Description:   A sulfonamide obtained by formal condensation of the sulfonic acid group of 4-[(3-methoxy-4-methylbenzoyl)amino]benzenesulfonic acid with the primary aromatic amino group of N-(3,5-dimethoxyphenyl)quinoxaline-2,3-diamine. A dual PI3K/mTOR inhibitor used in cancer treatment. ChEBI Compound Identification Number:   71958 ChEBI InChI Value:   InChI=1S/C31H29N5O6S/c1-19-9-10-20(15-28(19)42-4)31(37)33-21-11-13-25(14-12-21)43(38,39)36-30-29(34-26-7-5-6-8-27(26)35-30)32-22-16-23(40-2)18-24(17-22)41-3/h5-18H,1-4H3,(H,32,34)(H,33,37)(H,35,36) ChEBI InChIKey Value:   HJSSPYJVWLTYHG-UHFFFAOYSA-N ChEBI Compound Name:   XL765 ChEBI SMILES Value:   COc1cc(Nc2nc3ccccc3nc2NS(=O)(=O)c2ccc(NC(=O)c3ccc(C)c(OC)c3)cc2)cc(OC)c1 ChEBI Substance ID:   160962902 ChEBI URL:   ChEBI:71958 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   HJSSPYJVWLTYHG_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   49867926