Item 521 of 661 (back to results) previous next schweinfurthin H A stilbenoid isolated from Macaranga alnifolia and has been shwon to exhibit cytotoxic activity.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] × 05. Industrial Uses: pharmaceutical [CHEBI:52217] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   schweinfurthin H [CHEBI:66438] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   schweinfurthin H [CHEBI:66438] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   schweinfurthin H [CHEBI:66438] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   schweinfurthin H [CHEBI:66438] (1)  organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromanes [CHEBI:23230] (19)   schweinfurthin H [CHEBI:66438] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromanes [CHEBI:23230] (19)   schweinfurthin H [CHEBI:66438] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromanes [CHEBI:23230] (19)   schweinfurthin H [CHEBI:66438] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromanes [CHEBI:23230] (19)   schweinfurthin H [CHEBI:66438] (1)  organic heterotricyclic compound [CHEBI:26979] (541)   schweinfurthin H [CHEBI:66438] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromanes [CHEBI:23230] (19)   schweinfurthin H [CHEBI:66438] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   schweinfurthin H [CHEBI:66438] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromanes [CHEBI:23230] (19)   schweinfurthin H [CHEBI:66438] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromanes [CHEBI:23230] (19)   schweinfurthin H [CHEBI:66438] (1)  organic heterotricyclic compound [CHEBI:26979] (541)   schweinfurthin H [CHEBI:66438] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   stilbenoid [CHEBI:26776] (32)   schweinfurthin H [CHEBI:66438] (1)  phenols [CHEBI:33853] (868)   schweinfurthin H [CHEBI:66438] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   schweinfurthin H [CHEBI:66438] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   schweinfurthin H [CHEBI:66438] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromanes [CHEBI:23230] (19)   schweinfurthin H [CHEBI:66438] (1)  organic heterotricyclic compound [CHEBI:26979] (541)   schweinfurthin H [CHEBI:66438] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   schweinfurthin H [CHEBI:66438] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   stilbenoid [CHEBI:26776] (32)   schweinfurthin H [CHEBI:66438] (1)  phenols [CHEBI:33853] (868)   schweinfurthin H [CHEBI:66438] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromanes [CHEBI:23230] (19)   schweinfurthin H [CHEBI:66438] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromanes [CHEBI:23230] (19)   schweinfurthin H [CHEBI:66438] (1)  organic heterotricyclic compound [CHEBI:26979] (541)   schweinfurthin H [CHEBI:66438] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   stilbenoid [CHEBI:26776] (32)   schweinfurthin H [CHEBI:66438] (1)  phenols [CHEBI:33853] (868)   schweinfurthin H [CHEBI:66438] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   schweinfurthin H [CHEBI:66438] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromanes [CHEBI:23230] (19)   schweinfurthin H [CHEBI:66438] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromanes [CHEBI:23230] (19)   schweinfurthin H [CHEBI:66438] (1)  organic heterotricyclic compound [CHEBI:26979] (541)   schweinfurthin H [CHEBI:66438] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   schweinfurthin H [CHEBI:66438] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromanes [CHEBI:23230] (19)   schweinfurthin H [CHEBI:66438] (1)  organic heterotricyclic compound [CHEBI:26979] (541)   schweinfurthin H [CHEBI:66438] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromanes [CHEBI:23230] (19)   schweinfurthin H [CHEBI:66438] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromanes [CHEBI:23230] (19)   schweinfurthin H [CHEBI:66438] (1)  organic heterotricyclic compound [CHEBI:26979] (541)   schweinfurthin H [CHEBI:66438] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   stilbenoid [CHEBI:26776] (32)   schweinfurthin H [CHEBI:66438] (1)  phenols [CHEBI:33853] (868)   schweinfurthin H [CHEBI:66438] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   schweinfurthin H [CHEBI:66438] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   schweinfurthin H [CHEBI:66438] (1) ChEBI Compound Accession Identifier:   [CHEBI:66438] ChEBI Compound Description:   A stilbenoid isolated from Macaranga alnifolia and has been shwon to exhibit cytotoxic activity. ChEBI Compound Identification Number:   66438 ChEBI InChI Value:   InChI=1S/C30H38O7/c1-28(2)24-13-18-9-16(12-23(35-6)26(18)37-30(24,5)15-21(32)27(28)34)7-8-17-10-20(31)19-14-25(33)29(3,4)36-22(19)11-17/h7-12,21,24-25,27,31-34H,13-15H2,1-6H3/b8-7+/t21-,24-,25?,27-,30-/m1/s1 ChEBI InChIKey Value:   RFLJGOACFXZRHJ-ZHIKFPNPSA-N ChEBI Compound Name:   schweinfurthin H ChEBI SMILES Value:   [H][C@]12Cc3cc(\C=C\c4cc(O)c5CC(O)C(C)(C)Oc5c4)cc(OC)c3O[C@]1(C)C[C@@H](O)[C@@H](O)C2(C)C ChEBI Substance ID:   160709962 ChEBI URL:   ChEBI:66438 ChemSpider ID:   17273827 Ontomatica Chemical Accession Key (OnChAKey):   RFLJGOACFXZRHJ_ZHIKFPNPSA_N_000_000000 PubChem Compound ID:   16116602