New Search

Item 54 of 145 (back to results)
Previous previous next Next

brasixanthone B
A member of the class of pyranoxanthones that is 2H,6H-pyrano[3,2-b]xanthen-6-one substituted by hydroxy, geminal methyl and a prenyl group at positions 5, 8, 2 and 12 respectively. It is isolated from the stem bark of Calophyllum brasiliense and exhibits significant inhibitory activity against 12-O-tetradecanoylphorbol-13-acetate induced Epstein-Barr virus early antigen activation in Raji cells.


Current search:

07. Part of Biological Source of Chemical: plant structure [PO:0009011]
×
03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619]
×
05. Industrial Uses: pharmaceutical [CHEBI:52217]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 brasixanthone B [CHEBI:65519] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antineoplastic agent [CHEBI:35610] (760) 
 brasixanthone B [CHEBI:65519] (1)
06. Name of Biological Source of Chemical 
06. Name of Biological Source of Chemical
 Plantae (1926) 
 Magnoliophyta (1872) 
 Magnoliopsida (1649) 
 Malpighiales (287) 
 Calophyllaceae (28) 
 Calophyllum (11) 
 Calophyllum brasiliense (6)
07. Part of Biological Source of Chemical 
07. Part of Biological Source of Chemical
 plant structure [PO:0009011] (1497) 
 portion of plant tissue [PO:0009007] (272) 
 epidermis [PO:0005679] (134) 
 shoot epidermis [PO:0006035] (134) 
 shoot axis epidermis [PO:0000112] (134) 
 stem epidermis [PO:0025178] (134)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 brasixanthone B [CHEBI:65519] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 brasixanthone B [CHEBI:65519] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 pyranoxanthones [CHEBI:71238] (4) 
 brasixanthone B [CHEBI:65519] (1)
 oxacycle [CHEBI:38104] (2002) 
 pyranoxanthones [CHEBI:71238] (4) 
 brasixanthone B [CHEBI:65519] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 pyranoxanthones [CHEBI:71238] (4) 
 brasixanthone B [CHEBI:65519] (1)
 oxacycle [CHEBI:38104] (2002) 
 pyranoxanthones [CHEBI:71238] (4) 
 brasixanthone B [CHEBI:65519] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 pyranoxanthones [CHEBI:71238] (4) 
 brasixanthone B [CHEBI:65519] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotetracyclic compound [CHEBI:38163] (128) 
 pyranoxanthones [CHEBI:71238] (4) 
 brasixanthone B [CHEBI:65519] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 pyranoxanthones [CHEBI:71238] (4) 
 brasixanthone B [CHEBI:65519] (1)
 oxacycle [CHEBI:38104] (2002) 
 pyranoxanthones [CHEBI:71238] (4) 
 brasixanthone B [CHEBI:65519] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 brasixanthone B [CHEBI:65519] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 pyranoxanthones [CHEBI:71238] (4) 
 brasixanthone B [CHEBI:65519] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotetracyclic compound [CHEBI:38163] (128) 
 pyranoxanthones [CHEBI:71238] (4) 
 brasixanthone B [CHEBI:65519] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 brasixanthone B [CHEBI:65519] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 pyranoxanthones [CHEBI:71238] (4) 
 brasixanthone B [CHEBI:65519] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotetracyclic compound [CHEBI:38163] (128) 
 pyranoxanthones [CHEBI:71238] (4) 
 brasixanthone B [CHEBI:65519] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 brasixanthone B [CHEBI:65519] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 pyranoxanthones [CHEBI:71238] (4) 
 brasixanthone B [CHEBI:65519] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotetracyclic compound [CHEBI:38163] (128) 
 pyranoxanthones [CHEBI:71238] (4) 
 brasixanthone B [CHEBI:65519] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 brasixanthone B [CHEBI:65519] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 pyranoxanthones [CHEBI:71238] (4) 
 brasixanthone B [CHEBI:65519] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotetracyclic compound [CHEBI:38163] (128) 
 pyranoxanthones [CHEBI:71238] (4) 
 brasixanthone B [CHEBI:65519] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotetracyclic compound [CHEBI:38163] (128) 
 pyranoxanthones [CHEBI:71238] (4) 
 brasixanthone B [CHEBI:65519] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 pyranoxanthones [CHEBI:71238] (4) 
 brasixanthone B [CHEBI:65519] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotetracyclic compound [CHEBI:38163] (128) 
 pyranoxanthones [CHEBI:71238] (4) 
 brasixanthone B [CHEBI:65519] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 brasixanthone B [CHEBI:65519] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 pyranoxanthones [CHEBI:71238] (4) 
 brasixanthone B [CHEBI:65519] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 brasixanthone B [CHEBI:65519] (1)
ChEBI Compound Accession Identifier  [CHEBI:65519]
ChEBI Compound Description  A member of the class of pyranoxanthones that is 2H,6H-pyrano[3,2-b]xanthen-6-one substituted by hydroxy, geminal methyl and a prenyl group at positions 5, 8, 2 and 12 respectively. It is isolated from the stem bark of Calophyllum brasiliense and exhibits significant inhibitory activity against 12-O-tetradecanoylphorbol-13-acetate induced Epstein-Barr virus early antigen activation in Raji cells.
ChEBI Compound Identification Number  65519
ChEBI InChI Value  InChI=1S/C23H22O5/c1-12(2)5-7-15-21-14(9-10-23(3,4)28-21)19(25)18-20(26)16-11-13(24)6-8-17(16)27-22(15)18/h5-6,8-11,24-25H,7H2,1-4H3
ChEBI InChIKey Value  BFPCRQCNDMJVOT-UHFFFAOYSA-N
ChEBI Compound Name  brasixanthone B
ChEBI SMILES Value  CC(C)=CCc1c2OC(C)(C)C=Cc2c(O)c2c1oc1ccc(O)cc1c2=O
ChEBI Substance ID  160644933
ChEBI URL  ChEBI:65519
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  BFPCRQCNDMJVOT_UHFFFAOYSA_N_000_000000
PubChem Compound ID  10362269