New Search

Item 54 of 64 (back to results)
Previous previous next Next

ticagrelor
"A triazolopyrimidine that is an adenosine isostere; the cyclopentane ring is similar to ribose and the nitrogen-rich [1,2,3]triazolo[4,5-d]pyrimidine moiety resembles the nucleobase adenine. A platelet aggregation inhibitor which is used for prevention of thromboembolic events in patients with acute coronary syndrome."


Current search:

05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > hematologic agent [CHEBI:50248]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 pharmacological uses [CHEBI:52210] (736) 
 antagonist [CHEBI:48706] (126) 
 P2Y12 receptor antagonist [CHEBI:68563] (1) 
 ticagrelor [CHEBI:68558] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 hematologic agent [CHEBI:50248] (64) 
 platelet aggregation inhibitor [CHEBI:50427] (39) 
 ticagrelor [CHEBI:68558] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 hydroxyether [CHEBI:46789] (27) 
 ticagrelor [CHEBI:68558] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 fluorine molecular entity [CHEBI:24062] (288) 
 organofluorine compound [CHEBI:37143] (275) 
 ticagrelor [CHEBI:68558] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organofluorine compound [CHEBI:37143] (275) 
 ticagrelor [CHEBI:68558] (1)
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 triazolopyrimidines [CHEBI:48435] (3) 
 ticagrelor [CHEBI:68558] (1)
 organic amino compound [CHEBI:50047] (2472) 
 secondary amino compound [CHEBI:50995] (110) 
 ticagrelor [CHEBI:68558] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 hydroxyether [CHEBI:46789] (27) 
 ticagrelor [CHEBI:68558] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 hydroxyether [CHEBI:46789] (27) 
 ticagrelor [CHEBI:68558] (1)
 sulfur molecular entity [CHEBI:26835] (1541) 
 sulfide [CHEBI:26822] (86) 
 organic sulfide [CHEBI:16385] (82) 
 aryl sulfide [CHEBI:35683] (23) 
 ticagrelor [CHEBI:68558] (1)
 organosulfur compound [CHEBI:33261] (1005) 
 organic sulfide [CHEBI:16385] (82) 
 aryl sulfide [CHEBI:35683] (23) 
 ticagrelor [CHEBI:68558] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organic sulfide [CHEBI:16385] (82) 
 aryl sulfide [CHEBI:35683] (23) 
 ticagrelor [CHEBI:68558] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 hydroxyether [CHEBI:46789] (27) 
 ticagrelor [CHEBI:68558] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 triazolopyrimidines [CHEBI:48435] (3) 
 ticagrelor [CHEBI:68558] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 triazolopyrimidines [CHEBI:48435] (3) 
 ticagrelor [CHEBI:68558] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 triazolopyrimidines [CHEBI:48435] (3) 
 ticagrelor [CHEBI:68558] (1)
 organic amino compound [CHEBI:50047] (2472) 
 secondary amino compound [CHEBI:50995] (110) 
 ticagrelor [CHEBI:68558] (1)
 organohalogen compound [CHEBI:36684] (976) 
 organofluorine compound [CHEBI:37143] (275) 
 ticagrelor [CHEBI:68558] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organic sulfide [CHEBI:16385] (82) 
 aryl sulfide [CHEBI:35683] (23) 
 ticagrelor [CHEBI:68558] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 hydroxyether [CHEBI:46789] (27) 
 ticagrelor [CHEBI:68558] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 hydroxyether [CHEBI:46789] (27) 
 ticagrelor [CHEBI:68558] (1)
 organic amino compound [CHEBI:50047] (2472) 
 secondary amino compound [CHEBI:50995] (110) 
 ticagrelor [CHEBI:68558] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 triazolopyrimidines [CHEBI:48435] (3) 
 ticagrelor [CHEBI:68558] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 triazolopyrimidines [CHEBI:48435] (3) 
 ticagrelor [CHEBI:68558] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 triazolopyrimidines [CHEBI:48435] (3) 
 ticagrelor [CHEBI:68558] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 triazolopyrimidines [CHEBI:48435] (3) 
 ticagrelor [CHEBI:68558] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 triazolopyrimidines [CHEBI:48435] (3) 
 ticagrelor [CHEBI:68558] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 triazolopyrimidines [CHEBI:48435] (3) 
 ticagrelor [CHEBI:68558] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 triazolopyrimidines [CHEBI:48435] (3) 
 ticagrelor [CHEBI:68558] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 triazolopyrimidines [CHEBI:48435] (3) 
 ticagrelor [CHEBI:68558] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 triazolopyrimidines [CHEBI:48435] (3) 
 ticagrelor [CHEBI:68558] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 triazolopyrimidines [CHEBI:48435] (3) 
 ticagrelor [CHEBI:68558] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 triazolopyrimidines [CHEBI:48435] (3) 
 ticagrelor [CHEBI:68558] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 triazolopyrimidines [CHEBI:48435] (3) 
 ticagrelor [CHEBI:68558] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 hydroxyether [CHEBI:46789] (27) 
 ticagrelor [CHEBI:68558] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organofluorine compound [CHEBI:37143] (275) 
 ticagrelor [CHEBI:68558] (1)
ChEBI Compound Accession Identifier  [CHEBI:68558]
ChEBI Compound Description  "A triazolopyrimidine that is an adenosine isostere; the cyclopentane ring is similar to ribose and the nitrogen-rich [1,2,3]triazolo[4,5-d]pyrimidine moiety resembles the nucleobase adenine. A platelet aggregation inhibitor which is used for prevention of thromboembolic events in patients with acute coronary syndrome."
ChEBI Compound Identification Number  68558
ChEBI InChI Value  InChI=1S/C23H28F2N6O4S/c1-2-7-36-23-27-21(26-15-9-12(15)11-3-4-13(24)14(25)8-11)18-22(28-23)31(30-29-18)16-10-17(35-6-5-32)20(34)19(16)33/h3-4,8,12,15-17,19-20,32-34H,2,5-7,9-10H2,1H3,(H,26,27,28)/t12-,15+,16+,17-,19-,20+/m0/s1
ChEBI InChIKey Value  OEKWJQXRCDYSHL-FNOIDJSQSA-N
ChEBI Compound Name  ticagrelor
ChEBI SMILES Value  CCCSc1nc(N[C@@H]2C[C@H]2c2ccc(F)c(F)c2)c2nnn([C@@H]3C[C@H](OCCO)[C@@H](O)[C@H]3O)c2n1
ChEBI Substance ID  160645837
ChEBI URL  ChEBI:68558
ChemSpider ID  8047109
Ontomatica Chemical Accession Key (OnChAKey)  OEKWJQXRCDYSHL_FNOIDJSQSA_N_000_000000
PubChem Compound ID  9871419