New Search

Item 566 of 907 (back to results)
Previous previous next Next

fleephilone
A organic heterotetracyclic compound isolated from the fermentation broth of Trichoderma harzianum and exhibits anti-HIV activity.


Current search:

08. Chemical Category: main group molecular entity [CHEBI:33579]
×
03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 fleephilone [CHEBI:65900] (1)
 antimicrobial agent [CHEBI:33281] (927) 
 antiviral agent [CHEBI:22587] (216) 
 anti-HIV agent [CHEBI:64946] (126) 
 fleephilone [CHEBI:65900] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 fleephilone [CHEBI:65900] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 fleephilone [CHEBI:65900] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 fleephilone [CHEBI:65900] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 fleephilone [CHEBI:65900] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 diketone [CHEBI:46640] (53) 
 beta-diketone [CHEBI:67265] (31) 
 fleephilone [CHEBI:65900] (1)
 alpha,beta-unsaturated ketone [CHEBI:51721] (238) 
 enone [CHEBI:51689] (233) 
 fleephilone [CHEBI:65900] (1)
 carboxylic ester [CHEBI:33308] (1495) 
 fleephilone [CHEBI:65900] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 fleephilone [CHEBI:65900] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 fleephilone [CHEBI:65900] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 diketone [CHEBI:46640] (53) 
 beta-diketone [CHEBI:67265] (31) 
 fleephilone [CHEBI:65900] (1)
 alpha,beta-unsaturated ketone [CHEBI:51721] (238) 
 enone [CHEBI:51689] (233) 
 fleephilone [CHEBI:65900] (1)
 carboxylic ester [CHEBI:33308] (1495) 
 fleephilone [CHEBI:65900] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 fleephilone [CHEBI:65900] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 fleephilone [CHEBI:65900] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 fleephilone [CHEBI:65900] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotetracyclic compound [CHEBI:38163] (128) 
 fleephilone [CHEBI:65900] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 fleephilone [CHEBI:65900] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 cyclic ether [CHEBI:37407] (314) 
 fleephilone [CHEBI:65900] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 diketone [CHEBI:46640] (53) 
 beta-diketone [CHEBI:67265] (31) 
 fleephilone [CHEBI:65900] (1)
 alpha,beta-unsaturated ketone [CHEBI:51721] (238) 
 enone [CHEBI:51689] (233) 
 fleephilone [CHEBI:65900] (1)
 carboxylic ester [CHEBI:33308] (1495) 
 fleephilone [CHEBI:65900] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 fleephilone [CHEBI:65900] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 fleephilone [CHEBI:65900] (1)
 ester [CHEBI:35701] (3370) 
 carboxylic ester [CHEBI:33308] (1495) 
 fleephilone [CHEBI:65900] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 fleephilone [CHEBI:65900] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 fleephilone [CHEBI:65900] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotetracyclic compound [CHEBI:38163] (128) 
 fleephilone [CHEBI:65900] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 diketone [CHEBI:46640] (53) 
 beta-diketone [CHEBI:67265] (31) 
 fleephilone [CHEBI:65900] (1)
 alpha,beta-unsaturated ketone [CHEBI:51721] (238) 
 enone [CHEBI:51689] (233) 
 fleephilone [CHEBI:65900] (1)
 carboxylic ester [CHEBI:33308] (1495) 
 fleephilone [CHEBI:65900] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotetracyclic compound [CHEBI:38163] (128) 
 fleephilone [CHEBI:65900] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 fleephilone [CHEBI:65900] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 fleephilone [CHEBI:65900] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotetracyclic compound [CHEBI:38163] (128) 
 fleephilone [CHEBI:65900] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 fleephilone [CHEBI:65900] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 fleephilone [CHEBI:65900] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotetracyclic compound [CHEBI:38163] (128) 
 fleephilone [CHEBI:65900] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotetracyclic compound [CHEBI:38163] (128) 
 fleephilone [CHEBI:65900] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 fleephilone [CHEBI:65900] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ether [CHEBI:37407] (314) 
 fleephilone [CHEBI:65900] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotetracyclic compound [CHEBI:38163] (128) 
 fleephilone [CHEBI:65900] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 diketone [CHEBI:46640] (53) 
 beta-diketone [CHEBI:67265] (31) 
 fleephilone [CHEBI:65900] (1)
 alpha,beta-unsaturated ketone [CHEBI:51721] (238) 
 enone [CHEBI:51689] (233) 
 fleephilone [CHEBI:65900] (1)
 carboxylic ester [CHEBI:33308] (1495) 
 fleephilone [CHEBI:65900] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 fleephilone [CHEBI:65900] (1)
ChEBI Compound Accession Identifier  [CHEBI:65900]
ChEBI Compound Description  A organic heterotetracyclic compound isolated from the fermentation broth of Trichoderma harzianum and exhibits anti-HIV activity.
ChEBI Compound Identification Number  65900
ChEBI InChI Value  InChI=1S/C24H27NO7/c1-4-5-6-7-17-20-14-11-18(28)24(3,32-19(29)10-13(2)26)23(30)15(14)12-25-9-8-16(27)22(31-17)21(20)25/h4-7,11-13,16,21-22,26-27H,8-10H2,1-3H3/b5-4+,7-6+/t13?,16-,21+,22-,24?/m0/s1
ChEBI InChIKey Value  UOPRBHLVKJBASE-XVSBCJMYSA-N
ChEBI Compound Name  fleephilone
ChEBI SMILES Value  [H][C@]12OC(\C=C\C=C\C)=C3C4=CC(=O)C(C)(OC(=O)CC(C)O)C(=O)C4=CN(CC[C@@H]1O)[C@@]23[H]
ChEBI Substance ID  160709581
ChEBI URL  ChEBI:65900
ChemSpider ID  8750536
Ontomatica Chemical Accession Key (OnChAKey)  UOPRBHLVKJBASE_XVSBCJMYSA_N_000_000000
PubChem Compound ID  10575150