New Search

Item 572 of 661 (back to results)
Previous previous next Next

manassantin B
A lignan isolated from Saururus cernuus and Saururus chinensis and has been shown to exhibit antineoplastic activity.


Current search:

03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619]
×
05. Industrial Uses: pharmaceutical [CHEBI:52217]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 manassantin B [CHEBI:66664] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antineoplastic agent [CHEBI:35610] (760) 
 manassantin B [CHEBI:66664] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 manassantin B [CHEBI:66664] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 manassantin B [CHEBI:66664] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 dimethoxybenzene [CHEBI:51681] (14) 
 manassantin B [CHEBI:66664] (1)
 oxacycle [CHEBI:38104] (2002) 
 oxolanes [CHEBI:26912] (352) 
 manassantin B [CHEBI:66664] (1)
 benzodioxoles [CHEBI:38298] (21) 
 manassantin B [CHEBI:66664] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 dimethoxybenzene [CHEBI:51681] (14) 
 manassantin B [CHEBI:66664] (1)
 oxacycle [CHEBI:38104] (2002) 
 oxolanes [CHEBI:26912] (352) 
 manassantin B [CHEBI:66664] (1)
 benzodioxoles [CHEBI:38298] (21) 
 manassantin B [CHEBI:66664] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 oxolanes [CHEBI:26912] (352) 
 manassantin B [CHEBI:66664] (1)
 oxacycle [CHEBI:38104] (2002) 
 oxolanes [CHEBI:26912] (352) 
 manassantin B [CHEBI:66664] (1)
 benzodioxoles [CHEBI:38298] (21) 
 manassantin B [CHEBI:66664] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodioxoles [CHEBI:38298] (21) 
 manassantin B [CHEBI:66664] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 dimethoxybenzene [CHEBI:51681] (14) 
 manassantin B [CHEBI:66664] (1)
 oxacycle [CHEBI:38104] (2002) 
 oxolanes [CHEBI:26912] (352) 
 manassantin B [CHEBI:66664] (1)
 benzodioxoles [CHEBI:38298] (21) 
 manassantin B [CHEBI:66664] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 manassantin B [CHEBI:66664] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 oxolanes [CHEBI:26912] (352) 
 manassantin B [CHEBI:66664] (1)
 oxacycle [CHEBI:38104] (2002) 
 oxolanes [CHEBI:26912] (352) 
 manassantin B [CHEBI:66664] (1)
 benzodioxoles [CHEBI:38298] (21) 
 manassantin B [CHEBI:66664] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodioxoles [CHEBI:38298] (21) 
 manassantin B [CHEBI:66664] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 lignan [CHEBI:25036] (34) 
 manassantin B [CHEBI:66664] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 dimethoxybenzene [CHEBI:51681] (14) 
 manassantin B [CHEBI:66664] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodioxoles [CHEBI:38298] (21) 
 manassantin B [CHEBI:66664] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodioxoles [CHEBI:38298] (21) 
 manassantin B [CHEBI:66664] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 lignan [CHEBI:25036] (34) 
 manassantin B [CHEBI:66664] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 dimethoxybenzene [CHEBI:51681] (14) 
 manassantin B [CHEBI:66664] (1)
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 oxolanes [CHEBI:26912] (352) 
 manassantin B [CHEBI:66664] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 oxolanes [CHEBI:26912] (352) 
 manassantin B [CHEBI:66664] (1)
 oxacycle [CHEBI:38104] (2002) 
 oxolanes [CHEBI:26912] (352) 
 manassantin B [CHEBI:66664] (1)
 benzodioxoles [CHEBI:38298] (21) 
 manassantin B [CHEBI:66664] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodioxoles [CHEBI:38298] (21) 
 manassantin B [CHEBI:66664] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 lignan [CHEBI:25036] (34) 
 manassantin B [CHEBI:66664] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 dimethoxybenzene [CHEBI:51681] (14) 
 manassantin B [CHEBI:66664] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 oxolanes [CHEBI:26912] (352) 
 manassantin B [CHEBI:66664] (1)
 oxacycle [CHEBI:38104] (2002) 
 oxolanes [CHEBI:26912] (352) 
 manassantin B [CHEBI:66664] (1)
 benzodioxoles [CHEBI:38298] (21) 
 manassantin B [CHEBI:66664] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodioxoles [CHEBI:38298] (21) 
 manassantin B [CHEBI:66664] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 oxolanes [CHEBI:26912] (352) 
 manassantin B [CHEBI:66664] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodioxoles [CHEBI:38298] (21) 
 manassantin B [CHEBI:66664] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodioxoles [CHEBI:38298] (21) 
 manassantin B [CHEBI:66664] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 oxolanes [CHEBI:26912] (352) 
 manassantin B [CHEBI:66664] (1)
 oxacycle [CHEBI:38104] (2002) 
 oxolanes [CHEBI:26912] (352) 
 manassantin B [CHEBI:66664] (1)
 benzodioxoles [CHEBI:38298] (21) 
 manassantin B [CHEBI:66664] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodioxoles [CHEBI:38298] (21) 
 manassantin B [CHEBI:66664] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenylpropanoid [CHEBI:26004] (374) 
 lignan [CHEBI:25036] (34) 
 manassantin B [CHEBI:66664] (1)
 aromatic ether [CHEBI:35618] (353) 
 methoxybenzene [CHEBI:51683] (61) 
 dimethoxybenzene [CHEBI:51681] (14) 
 manassantin B [CHEBI:66664] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 secondary alcohol [CHEBI:35681] (342) 
 manassantin B [CHEBI:66664] (1)
ChEBI Compound Accession Identifier  [CHEBI:66664]
ChEBI Compound Description  A lignan isolated from Saururus cernuus and Saururus chinensis and has been shown to exhibit antineoplastic activity.
ChEBI Compound Identification Number  66664
ChEBI InChI Value  InChI=1S/C41H48O11/c1-22-23(2)41(29-12-16-33(36(20-29)47-8)51-25(4)39(43)27-10-14-31-37(18-27)49-21-48-31)52-40(22)28-11-15-32(35(19-28)46-7)50-24(3)38(42)26-9-13-30(44-5)34(17-26)45-6/h9-20,22-25,38-43H,21H2,1-8H3/t22-,23-,24-,25-,38+,39+,40+,41+/m1/s1
ChEBI InChIKey Value  GSWZMFDCPMPHDL-FZBBBUCASA-N
ChEBI Compound Name  manassantin B
ChEBI SMILES Value  COc1ccc(cc1OC)[C@@H](O)[C@@H](C)Oc1ccc(cc1OC)[C@H]1O[C@@H]([C@H](C)[C@H]1C)c1ccc(O[C@H](C)[C@H](O)c2ccc3OCOc3c2)c(OC)c1
ChEBI Substance ID  160710269
ChEBI URL  ChEBI:66664
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  GSWZMFDCPMPHDL_FZBBBUCASA_N_000_000000
PubChem Compound ID  10439828