| more general categories |
information about this item |
|
| 04. Bioactive Capabilities of Specific Chemicals |
 |
|
|
|
|
04. Bioactive Capabilities of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dihydroxynicotinate [CHEBI:58780] (1) |
|
|
| 08. Chemical Category |
|
|
|
|
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dihydroxynicotinate [CHEBI:58780] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dihydroxynicotinate [CHEBI:58780] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dihydroxynicotinate [CHEBI:58780] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dihydroxynicotinate [CHEBI:58780] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dihydroxynicotinate [CHEBI:58780] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dihydroxynicotinate [CHEBI:58780] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dihydroxynicotinate [CHEBI:58780] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,6-dihydroxynicotinate [CHEBI:58780] (1) |
|
|
| ChEBI Compound Accession Identifier: |
[CHEBI:58780] |
| ChEBI Compound Description: |
Conjugate base of 2,6-dihydroxynicotinic acid. |
| ChEBI Compound Identification Number: |
58780 |
| ChEBI InChI Value: |
InChI=1S/C6H5NO4/c8-4-2-1-3(6(10)11)5(9)7-4/h1-2H,(H,10,11)(H2,7,8,9)/p-1 |
| ChEBI InChIKey Value: |
IGCZQNUHGOYVJI-UHFFFAOYSA-M |
| ChEBI Compound Name: |
2,6-dihydroxynicotinate |
| ChEBI SMILES Value: |
Oc1ccc(C([O-])=O)c(O)n1 |
| ChEBI Substance ID: |
92741654 |
| ChEBI URL: |
ChEBI:58780 |
| ChemSpider ID: |
NS |
| Ontomatica Chemical Accession Key (OnChAKey): |
IGCZQNUHGOYVJI_UHFFFAOYSA_M_000_000000 |
| PubChem Compound ID: |
23640719 |
