more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
![](pixel.gif) |
![](pixel.gif) |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
Fish (5) |
|
|
Milk (61) |
|
|
Cattle, fat (61) |
|
|
Cattle, kidney (13) |
|
|
Cattle, meat (59) |
|
|
Cattle, meat byproducts (except kidney) (5) |
|
|
Goat, fat (57) |
|
|
Goat, kidney (12) |
|
|
Goat, meat (56) |
|
|
Goat, meat byproducts (except kidney) (5) |
|
|
Horse, fat (57) |
|
|
Horse, kidney (12) |
|
|
Horse, meat (54) |
|
|
Horse, meat byproducts (except kidney) (5) |
|
|
Sheep, fat (57) |
|
|
Sheep, kidney (12) |
|
|
Sheep, meat (56) |
|
|
Sheep, meat byproducts (except kidney) (5) |
|
|
|
|
|
Asparagus (23) |
|
|
Avocado (23) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 01 : Root & Tuber Vegetables Group (7) |
|
|
|
|
|
Potato (33) |
|
|
Potato (33) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 02 : Leaves of Root & Tuber Vegetables (Human Food or Animal Feed) Group (10) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 03 : Bulb Vegetables { Allium spp. } Group (1) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 04 : Leafy Vegetables (except Brassica Vegetables) Group (21) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 05 : Brassica (Cole) Leafy Vegetables Group (11) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 06 : Legume Vegetables (Succulent or Dried) Group (6) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 07 : Foliage of Legume Vegetables Group (9) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 08-10 : Fruiting Vegetable Group (34) |
|
|
|
|
|
Okra (17) |
|
|
|
|
|
Okra (17) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 09 : Cucurbit Vegetables Group (29) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10 : Citrus Fruit Group (22) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 11 : Pome Fruits Group (26) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 12 : Stone Fruits Group (29) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 13 : Berries Group (7) |
|
|
|
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Strawberry (23) |
|
|
Cranberry (27) |
|
|
Strawberry (23) |
|
|
|
|
|
Cranberry (27) |
|
|
Cranberry (27) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 14 : Tree Nuts Group (28) |
|
|
Almond (46) |
|
|
Almond (46) |
|
|
|
|
|
Almond (46) |
|
|
Almond (46) |
|
|
Pistachio (28) |
|
|
|
|
|
Rice, grain (19) |
|
|
Sorghum, grain (28) |
|
|
Wheat, grain (22) |
|
|
Barley, grain (18) |
|
|
Rice, grain (19) |
|
|
Rye, grain (5) |
|
|
Wheat, grain (22) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 16 : Forage, Fodder & Straw of Cereal Grains Group (31) |
|
|
Wheat, forage (23) |
|
|
Wheat, straw (24) |
|
|
|
|
|
Millet, forage (2) |
|
|
Oat, forage (13) |
|
|
Rye, forage (8) |
|
|
Teff, forage (3) |
|
|
Wheat, forage (23) |
|
|
Barley, straw (16) |
|
|
Millet, straw (2) |
|
|
Oat, straw (14) |
|
|
Rye, straw (8) |
|
|
Teff, straw (2) |
|
|
Wheat, straw (24) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 17 : Grass Forage, Fodder & Hay Group (26) |
|
|
|
|
|
Soybean, forage (17) |
|
|
Teff, forage (3) |
|
|
Soybean, hay (17) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 18 : Nongrass Animal Feeds (Forage, Fodder, Straw & Hay) Group (11) |
|
![](pixel.gif) |
03. Biological Effects of Specific Chemicals |
![](pixel.gif) |
![](pixel.gif) |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
![](pixel.gif) |
05. Industrial Uses |
![](pixel.gif) |
![](pixel.gif) |
|
05. Industrial Uses |
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
2,4-D [CHEBI:28854] (1) |
|
![](pixel.gif) |
08. Chemical Category |
![](pixel.gif) |
![](pixel.gif) |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
|
|
|
|
|
|
|
|
|
|
2,4-D [CHEBI:28854] (1) |
|
![](pixel.gif) |
ChEBI Compound Accession Identifier: |
[CHEBI:28854] |
ChEBI Compound Description: |
A chlorophenoxyacetic acid that is phenoxyacetic acid in which the ring hydrogens at postions 2 and 4 are substituted by chlorines. |
ChEBI Compound Identification Number: |
28854 |
ChEBI InChI Value: |
InChI=1S/C8H6Cl2O3/c9-5-1-2-7(6(10)3-5)13-4-8(11)12/h1-3H,4H2,(H,11,12) |
ChEBI InChIKey Value: |
OVSKIKFHRZPJSS-UHFFFAOYSA-N |
ChEBI Compound Name: |
2,4-D |
ChEBI SMILES Value: |
OC(=O)COc1ccc(Cl)cc1Cl |
ChEBI Substance ID: |
24398013 |
ChEBI URL: |
ChEBI:28854 |
ChemSpider ID: |
NS |
Ontomatica Chemical Accession Key (OnChAKey): |
OVSKIKFHRZPJSS_UHFFFAOYSA_N_000_000000 |
PubChem Compound ID: |
1486 |