Item 7 of 412 (back to results) previous next aristolochic acid A monocarboxylic acid that is phenanthrene-1-carboxylic acid that is substituted by a methylenedioxy group at the 3,4 positions, by a methoxy group at position 8, and by a nitro group at position 10. It is the most abundant of the aristolochic acids and is found in almost all Aristolochia (birthworts or pipevines) species. It has been tried in a number of treatments for inflammatory disorders, mainly in Chinese and folk medicine. However, there is concern over their use as aristolochic acid is both carcinogenic and nephrotoxic.

Current search: 06. Name of Biological Source of Chemical: Plantae > Magnoliophyta × 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   aristolochic acid [CHEBI:2825] (1)  toxin [CHEBI:27026] (45)   aristolochic acid [CHEBI:2825] (1)  aetiopathogenetic uses [CHEBI:52209] (178)   genotoxin [CHEBI:50902] (78)   mutagen [CHEBI:25435] (74)   aristolochic acid [CHEBI:2825] (1)  carcinogenic agent [CHEBI:50903] (40)   aristolochic acid [CHEBI:2825] (1)  poison [CHEBI:64909] (7)   nephrotoxin [CHEBI:61015] (5)   aristolochic acid [CHEBI:2825] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Plantae (1926)   Magnoliophyta (1872)   Magnoliopsida (1649)   Piperales (63)   Aristolochiaceae (1)   Aristolochia (1) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  unspecified structure [PO:0000004] (703) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   aristolochic acid [CHEBI:2825] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   nitro compound [CHEBI:35715] (192)   C-nitro compound [CHEBI:35716] (171)   aristolochic acid [CHEBI:2825] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   aristolochic acid [CHEBI:2825] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   aristolochic acid [CHEBI:2825] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   aristolochic acid [CHEBI:2825] (1)  acetal [CHEBI:59769] (62)   cyclic acetal [CHEBI:59770] (28)   aristolochic acid [CHEBI:2825] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   aristolochic acid [CHEBI:2825] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   aristolochic acid [CHEBI:2825] (1)  acetal [CHEBI:59769] (62)   cyclic acetal [CHEBI:59770] (28)   aristolochic acid [CHEBI:2825] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   aristolochic acid [CHEBI:2825] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   aristolochic acid [CHEBI:2825] (1)  acetal [CHEBI:59769] (62)   cyclic acetal [CHEBI:59770] (28)   aristolochic acid [CHEBI:2825] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   aristolochic acid [CHEBI:2825] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   phenanthrenes [CHEBI:25961] (56)   aristolochic acid [CHEBI:2825] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   phenanthrenes [CHEBI:25961] (56)   aristolochic acid [CHEBI:2825] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   phenanthrenes [CHEBI:25961] (56)   aristolochic acid [CHEBI:2825] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   phenanthrenes [CHEBI:25961] (56)   aristolochic acid [CHEBI:2825] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   aristolochic acid [CHEBI:2825] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   phenanthrenes [CHEBI:25961] (56)   aristolochic acid [CHEBI:2825] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   phenanthrenes [CHEBI:25961] (56)   aristolochic acid [CHEBI:2825] (1)  homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   phenanthrenes [CHEBI:25961] (56)   aristolochic acid [CHEBI:2825] (1)  polycyclic compound [CHEBI:33635] (4078)   homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   phenanthrenes [CHEBI:25961] (56)   aristolochic acid [CHEBI:2825] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   phenanthrenes [CHEBI:25961] (56)   aristolochic acid [CHEBI:2825] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   phenanthrenes [CHEBI:25961] (56)   aristolochic acid [CHEBI:2825] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   phenanthrenes [CHEBI:25961] (56)   aristolochic acid [CHEBI:2825] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   phenanthrenes [CHEBI:25961] (56)   aristolochic acid [CHEBI:2825] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   phenanthrenes [CHEBI:25961] (56)   aristolochic acid [CHEBI:2825] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   phenanthrenes [CHEBI:25961] (56)   aristolochic acid [CHEBI:2825] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   phenanthrenes [CHEBI:25961] (56)   aristolochic acid [CHEBI:2825] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   phenanthrenes [CHEBI:25961] (56)   aristolochic acid [CHEBI:2825] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   phenanthrenes [CHEBI:25961] (56)   aristolochic acid [CHEBI:2825] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   phenanthrenes [CHEBI:25961] (56)   aristolochic acid [CHEBI:2825] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   aristolochic acid [CHEBI:2825] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   aristolochic acid [CHEBI:2825] (1) ChEBI Compound Accession Identifier:   [CHEBI:2825] ChEBI Compound Description:   A monocarboxylic acid that is phenanthrene-1-carboxylic acid that is substituted by a methylenedioxy group at the 3,4 positions, by a methoxy group at position 8, and by a nitro group at position 10. It is the most abundant of the aristolochic acids and is found in almost all Aristolochia (birthworts or pipevines) species. It has been tried in a number of treatments for inflammatory disorders, mainly in Chinese and folk medicine. However, there is concern over their use as aristolochic acid is both carcinogenic and nephrotoxic. ChEBI Compound Identification Number:   2825 ChEBI InChI Value:   InChI=1S/C17H11NO7/c1-23-12-4-2-3-8-9(12)5-11(18(21)22)14-10(17(19)20)6-13-16(15(8)14)25-7-24-13/h2-6H,7H2,1H3,(H,19,20) ChEBI InChIKey Value:   BBFQZRXNYIEMAW-UHFFFAOYSA-N ChEBI Compound Name:   aristolochic acid ChEBI SMILES Value:   COc1cccc2c1cc([N+]([O-])=O)c1c(cc3OCOc3c21)C(O)=O ChEBI Substance ID:   135610160 ChEBI URL:   ChEBI:2825 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   BBFQZRXNYIEMAW_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   2236