New Search

Item 7 of 18 (back to results)
Previous previous next Next

chaetoxanthone B
A bridged organic heteropentacyclic compound that is 3,4,5,6-tetrahydro-2H,8H-2,6-epoxyoxocino[3,2-b]xanthen-8-one substituted by a hydroxy group at position 7, a methoxy group at position 9 and a methyl group at position 2. It is isolated from the marine derived fungus Chaetomium and has antiprotozoal activity.

Current search:

07. Part of Biological Source of Chemical: unspecified structure [PO:0000004]
×
03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > antimicrobial drug [CHEBI:36043]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 chaetoxanthone B [CHEBI:65612] (1)
 antimicrobial agent [CHEBI:33281] (927) 
 antimicrobial drug [CHEBI:36043] (169) 
 antiprotozoal drug [CHEBI:35820] (168) 
 chaetoxanthone B [CHEBI:65612] (1)
06. Name of Biological Source of Chemical 
06. Name of Biological Source of Chemical
 Fungi, Yeasts, Molds and Mildews (348) 
 Dikarya (97) 
 Ascomycota (82) 
 Pezizomycotina (82) 
 Sordariomycetes (72) 
 Sordariomycetidae (30) 
 Sordariales (30) 
 Chaetomiaceae (28) 
 Chaetomium (28)
07. Part of Biological Source of Chemical 
07. Part of Biological Source of Chemical
 unspecified structure [PO:0000004] (703)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 chaetoxanthone B [CHEBI:65612] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 chaetoxanthone B [CHEBI:65612] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 chaetoxanthone B [CHEBI:65612] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ketal [CHEBI:59779] (29) 
 chaetoxanthone B [CHEBI:65612] (1)
 acetal [CHEBI:59769] (62) 
 ketal [CHEBI:59777] (29) 
 cyclic ketal [CHEBI:59779] (29) 
 chaetoxanthone B [CHEBI:65612] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 chaetoxanthone B [CHEBI:65612] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ketal [CHEBI:59779] (29) 
 chaetoxanthone B [CHEBI:65612] (1)
 acetal [CHEBI:59769] (62) 
 ketal [CHEBI:59777] (29) 
 cyclic ketal [CHEBI:59779] (29) 
 chaetoxanthone B [CHEBI:65612] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ketal [CHEBI:59779] (29) 
 chaetoxanthone B [CHEBI:65612] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteropentacyclic compound [CHEBI:38164] (100) 
 chaetoxanthone B [CHEBI:65612] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 chaetoxanthone B [CHEBI:65612] (1)
 oxacycle [CHEBI:38104] (2002) 
 cyclic ketal [CHEBI:59779] (29) 
 chaetoxanthone B [CHEBI:65612] (1)
 acetal [CHEBI:59769] (62) 
 ketal [CHEBI:59777] (29) 
 cyclic ketal [CHEBI:59779] (29) 
 chaetoxanthone B [CHEBI:65612] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 chaetoxanthone B [CHEBI:65612] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ketal [CHEBI:59779] (29) 
 chaetoxanthone B [CHEBI:65612] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteropentacyclic compound [CHEBI:38164] (100) 
 chaetoxanthone B [CHEBI:65612] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 chaetoxanthone B [CHEBI:65612] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 chaetoxanthone B [CHEBI:65612] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteropentacyclic compound [CHEBI:38164] (100) 
 chaetoxanthone B [CHEBI:65612] (1)
 bridged compound [CHEBI:35990] (118) 
 chaetoxanthone B [CHEBI:65612] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 chaetoxanthone B [CHEBI:65612] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ketal [CHEBI:59779] (29) 
 chaetoxanthone B [CHEBI:65612] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteropentacyclic compound [CHEBI:38164] (100) 
 chaetoxanthone B [CHEBI:65612] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 chaetoxanthone B [CHEBI:65612] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ketal [CHEBI:59779] (29) 
 chaetoxanthone B [CHEBI:65612] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteropentacyclic compound [CHEBI:38164] (100) 
 chaetoxanthone B [CHEBI:65612] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteropentacyclic compound [CHEBI:38164] (100) 
 chaetoxanthone B [CHEBI:65612] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 cyclic ketal [CHEBI:59779] (29) 
 chaetoxanthone B [CHEBI:65612] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heteropentacyclic compound [CHEBI:38164] (100) 
 chaetoxanthone B [CHEBI:65612] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 chaetoxanthone B [CHEBI:65612] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 chaetoxanthone B [CHEBI:65612] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 chaetoxanthone B [CHEBI:65612] (1)
ChEBI Compound Accession Identifier:   [CHEBI:65612]
ChEBI Compound Description:   A bridged organic heteropentacyclic compound that is 3,4,5,6-tetrahydro-2H,8H-2,6-epoxyoxocino[3,2-b]xanthen-8-one substituted by a hydroxy group at position 7, a methoxy group at position 9 and a methyl group at position 2. It is isolated from the marine derived fungus Chaetomium and has antiprotozoal activity.
ChEBI Compound Identification Number:   65612
ChEBI InChI Value:   InChI=1S/C20H18O6/c1-20-8-4-7-12(25-20)16-14(26-20)9-13-17(19(16)22)18(21)15-10(23-2)5-3-6-11(15)24-13/h3,5-6,9,12,22H,4,7-8H2,1-2H3
ChEBI InChIKey Value:   ZUEKQPJBVORAFH-UHFFFAOYSA-N
ChEBI Compound Name:   chaetoxanthone B
ChEBI SMILES Value:   COc1cccc2oc3cc4OC5(C)CCCC(O5)c4c(O)c3c(=O)c12
ChEBI Substance ID:   160645255
ChEBI URL:   ChEBI:65612
ChemSpider ID:   24720687
Ontomatica Chemical Accession Key (OnChAKey):   ZUEKQPJBVORAFH_UHFFFAOYSA_N_000_000000
PubChem Compound ID:   44586906