New Search

Item 7 of 8 (back to results)
Previous previous next Next

zuclopenthixol
The (Z)-isomer of clopenthixol.


Current search:

03. Biological Effects of Specific Chemicals: pharmacological uses [CHEBI:52210] > neurotransmitter agent [CHEBI:35942] > adrenergic agent [CHEBI:37962] > adrenergic antagonist [CHEBI:37887] > alpha-adrenergic antagonist [CHEBI:37890]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 pharmacological uses [CHEBI:52210] (736) 
 neurotransmitter agent [CHEBI:35942] (471) 
 histaminergic drug [CHEBI:37957] (94) 
 histamine antagonist [CHEBI:37956] (87) 
 H1-receptor antagonist [CHEBI:37955] (57) 
 zuclopenthixol [CHEBI:51364] (1)
 adrenergic agent [CHEBI:37962] (143) 
 adrenergic antagonist [CHEBI:37887] (75) 
 alpha-adrenergic antagonist [CHEBI:37890] (28) 
 zuclopenthixol [CHEBI:51364] (1)
 serotonergic drug [CHEBI:48278] (109) 
 serotonergic antagonist [CHEBI:48279] (52) 
 zuclopenthixol [CHEBI:51364] (1)
 dopaminergic agent [CHEBI:48560] (99) 
 dopaminergic antagonist [CHEBI:48561] (48) 
 zuclopenthixol [CHEBI:51364] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 central nervous system drug [CHEBI:35470] (217) 
 psychotropic drug [CHEBI:35471] (130) 
 tranquilizing drug [CHEBI:35473] (83) 
 antipsychotic agent [CHEBI:35476] (51) 
 first generation antipsychotic [CHEBI:65190] (30) 
 zuclopenthixol [CHEBI:51364] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 primary alcohol [CHEBI:15734] (167) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 primary alcohol [CHEBI:15734] (167) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 thioxanthenes [CHEBI:50930] (8) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 primary alcohol [CHEBI:15734] (167) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (56) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 thioxanthenes [CHEBI:50930] (8) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 thioxanthenes [CHEBI:50930] (8) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 thioxanthenes [CHEBI:50930] (0) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (0)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 thioxanthenes [CHEBI:50930] (133) 
 clopenthixol [CHEBI:59115] (0) 
 zuclopenthixol [CHEBI:51364] (0)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 thioxanthenes [CHEBI:50930] (0) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (1)
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (0) 
 piperazines [CHEBI:26144] (1) 
 N-alkylpiperazine [CHEBI:46845] (1978) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (0)
 organic cyclic compound [CHEBI:33832] (0) 
 organic heterocyclic compound [CHEBI:24532] (0) 
 organic heteromonocyclic compound [CHEBI:25693] (1926) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (90) 
 clopenthixol [CHEBI:59115] (0) 
 zuclopenthixol [CHEBI:51364] (0)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (36) 
 N-alkylpiperazine [CHEBI:46845] (0) 
 clopenthixol [CHEBI:59115] (29) 
 zuclopenthixol [CHEBI:51364] (486)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (170) 
 thioxanthenes [CHEBI:50930] (8) 
 clopenthixol [CHEBI:59115] (7287) 
 zuclopenthixol [CHEBI:51364] (1)
 organic polycyclic compound [CHEBI:51958] (5641) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (0) 
 thioxanthenes [CHEBI:50930] (0) 
 clopenthixol [CHEBI:59115] (25343) 
 zuclopenthixol [CHEBI:51364] (15225)
 heterocyclic compound [CHEBI:5686] (0) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperazines [CHEBI:26144] (0) 
 N-alkylpiperazine [CHEBI:46845] (0) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (11352) 
 piperazines [CHEBI:26144] (5928) 
 N-alkylpiperazine [CHEBI:46845] (0) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (0)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 thioxanthenes [CHEBI:50930] (23769) 
 clopenthixol [CHEBI:59115] (0) 
 zuclopenthixol [CHEBI:51364] (11874)
 heteromonocyclic compound [CHEBI:33670] (5928) 
 organic heteromonocyclic compound [CHEBI:25693] (0) 
 piperazines [CHEBI:26144] (0) 
 N-alkylpiperazine [CHEBI:46845] (868) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (1)
 heteropolycyclic compound [CHEBI:33671] (3593) 
 heterotricyclic compound [CHEBI:36688] (868) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 thioxanthenes [CHEBI:50930] (8) 
 clopenthixol [CHEBI:59115] (0) 
 zuclopenthixol [CHEBI:51364] (5932)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (0) 
 thioxanthenes [CHEBI:50930] (8) 
 clopenthixol [CHEBI:59115] (0) 
 zuclopenthixol [CHEBI:51364] (0)
 organic molecule [CHEBI:72695] (0) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (0) 
 piperazines [CHEBI:26144] (111) 
 N-alkylpiperazine [CHEBI:46845] (0) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperazines [CHEBI:26144] (1) 
 N-alkylpiperazine [CHEBI:46845] (0) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (0)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (35) 
 thioxanthenes [CHEBI:50930] (8) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (0) 
 organic heterotricyclic compound [CHEBI:26979] (13672) 
 thioxanthenes [CHEBI:50930] (8) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1) 
 primary alcohol [CHEBI:15734] (111) 
 clopenthixol [CHEBI:59115] (2) 
 zuclopenthixol [CHEBI:51364] (1)
ChEBI Compound Accession Identifier  [CHEBI:51364]
ChEBI Compound Description  The (Z)-isomer of clopenthixol.
ChEBI Compound Identification Number  51364
ChEBI InChI Value  InChI=1S/C22H25ClN2OS/c23-17-7-8-22-20(16-17)18(19-4-1-2-6-21(19)27-22)5-3-9-24-10-12-25(13-11-24)14-15-26/h1-2,4-8,16,26H,3,9-15H2/b18-5-
ChEBI InChIKey Value  WFPIAZLQTJBIFN-DVZOWYKESA-N
ChEBI Compound Name  zuclopenthixol
ChEBI SMILES Value  OCCN1CCN(CC\\C=C2\\c3ccccc3Sc3ccc(Cl)cc23)CC1
ChEBI Substance ID  56464310
ChEBI URL  ChEBI:51364
ChemSpider ID  0
Ontomatica Chemical Accession Key (OnChAKey)  WFPIAZLQTJBIFN_DVZOWYKESA_N_000_000000
PubChem Compound ID  5311507