New Search

Item 7 of 15 (back to results)
Previous previous next Next

flavoxate
A carboxylic ester resulting from the formal condensation of 3-methylflavone-8-carboxylic acid with 2-(1-piperidinyl)ethanol.


Current search:

05. Industrial Uses: pharmaceutical [CHEBI:52217]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 pharmacological uses [CHEBI:52210] (736) 
 neurotransmitter agent [CHEBI:35942] (471) 
 cholinergic drug [CHEBI:38323] (108) 
 cholinergic antagonist [CHEBI:48873] (84) 
 muscarinic antagonist [CHEBI:48876] (61) 
 flavoxate [CHEBI:5088] (1)
 parasympatholytic [CHEBI:50370] (17) 
 flavoxate [CHEBI:5088] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 neuromuscular agent [CHEBI:51372] (51) 
 muscle relaxant [CHEBI:51371] (47) 
 antispasmodic drug [CHEBI:53784] (18) 
 flavoxate [CHEBI:5088] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 flavoxate [CHEBI:5088] (1)
 organic amino compound [CHEBI:50047] (2472) 
 tertiary amino compound [CHEBI:50996] (199) 
 flavoxate [CHEBI:5088] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 flavoxate [CHEBI:5088] (1)
 flavonoids [CHEBI:72544] (433) 
 flavonoid [CHEBI:47916] (301) 
 flavones [CHEBI:24043] (130) 
 flavoxate [CHEBI:5088] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 flavoxate [CHEBI:5088] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 flavoxate [CHEBI:5088] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 flavoxate [CHEBI:5088] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 flavoxate [CHEBI:5088] (1)
 organic amino compound [CHEBI:50047] (2472) 
 tertiary amino compound [CHEBI:50996] (199) 
 flavoxate [CHEBI:5088] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 flavoxate [CHEBI:5088] (1)
 ester [CHEBI:35701] (3370) 
 carboxylic ester [CHEBI:33308] (1495) 
 flavoxate [CHEBI:5088] (1)
 organic amino compound [CHEBI:50047] (2472) 
 tertiary amino compound [CHEBI:50996] (199) 
 flavoxate [CHEBI:5088] (1)
 flavonoids [CHEBI:72544] (433) 
 flavonoid [CHEBI:47916] (301) 
 flavones [CHEBI:24043] (130) 
 flavoxate [CHEBI:5088] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 flavoxate [CHEBI:5088] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 flavoxate [CHEBI:5088] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 flavoxate [CHEBI:5088] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 flavoxate [CHEBI:5088] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 flavoxate [CHEBI:5088] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 flavoxate [CHEBI:5088] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 flavoxate [CHEBI:5088] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 flavoxate [CHEBI:5088] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 flavoxate [CHEBI:5088] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 flavoxate [CHEBI:5088] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 flavoxate [CHEBI:5088] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 flavoxate [CHEBI:5088] (1)
ChEBI Compound Accession Identifier  [CHEBI:5088]
ChEBI Compound Description  A carboxylic ester resulting from the formal condensation of 3-methylflavone-8-carboxylic acid with 2-(1-piperidinyl)ethanol.
ChEBI Compound Identification Number  5088
ChEBI InChI Value  InChI=1S/C24H25NO4/c1-17-21(26)19-11-8-12-20(23(19)29-22(17)18-9-4-2-5-10-18)24(27)28-16-15-25-13-6-3-7-14-25/h2,4-5,8-12H,3,6-7,13-16H2,1H3
ChEBI InChIKey Value  SPIUTQOUKAMGCX-UHFFFAOYSA-N
ChEBI Compound Name  flavoxate
ChEBI SMILES Value  Cc1c(oc2c(cccc2c1=O)C(=O)OCCN1CCCCC1)-c1ccccc1
ChEBI Substance ID  111978146
ChEBI URL  ChEBI:5088
ChemSpider ID  3237
Ontomatica Chemical Accession Key (OnChAKey)  SPIUTQOUKAMGCX_UHFFFAOYSA_N_000_000000
PubChem Compound ID  3354