| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
 |
| 05. Industrial Uses |
 |
 |
|
05. Industrial Uses |
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
|
|
|
|
|
|
|
|
|
|
globostellatic acid D [CHEBI:72310] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:72310] |
| ChEBI Compound Description: |
A tricyclic triterpenoid of the isomalabaricane group. |
| ChEBI Compound Identification Number: |
72310 |
| ChEBI InChI Value: |
InChI=1S/C31H46O6/c1-19(12-13-25(37-8)28(3,4)36)10-9-11-20(2)26-21(32)18-23-29(5)17-15-24(33)31(7,27(34)35)22(29)14-16-30(23,26)6/h9-13,22-25,33,36H,14-18H2,1-8H3,(H,34,35)/b11-9+,13-12+,19-10+,26-20+/t22-,23+,24-,25?,29+,30+,31-/m1/s1 |
| ChEBI InChIKey Value: |
SZHMATBACCQYNZ-LMRICTRBSA-N |
| ChEBI Compound Name: |
globostellatic acid D |
| ChEBI SMILES Value: |
[H][C@@]12CC[C@@]3(C)[C@@]([H])(CC(=O)\C3=C(C)/C=C/C=C(C)/C=C/C(OC)C(C)(C)O)[C@@]1(C)CC[C@@H](O)[C@]2(C)C(O)=O |
| ChEBI Substance ID: |
160962979 |
| ChEBI URL: |
ChEBI:72310 |
| ChemSpider ID: |
NS |
| Ontomatica Chemical Accession Key (OnChAKey): |
SZHMATBACCQYNZ_LMRICTRBSA_N_000_000000 |
| PubChem Compound ID: |
10839555 |