New Search

Item 689 of 749 (back to results)
Previous previous next Next

ioflupane I(123)
An azabicycloalkane that is ecgonine methyl ester in which the N-methyl group is replaced by 3-fluoropropyl and the 3beta-hydroxy group is replaced by 4-((123)I)iodophenyl. Used for the imaging of dopamine transporters in the brain of adult patients with potential Parkinsonian Syndromes.


Current search:

05. Industrial Uses: pharmaceutical [CHEBI:52217]
×

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 diagnostic agent [CHEBI:33295] (53) 
 diagnostic imaging agent [CHEBI:37334] (32) 
 radioactive imaging agent [CHEBI:37336] (6) 
 ioflupane I(123) [CHEBI:68855] (1)
 radiopharmaceutical [CHEBI:35232] (1) 
 ioflupane I(123) [CHEBI:68855] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 fluorine molecular entity [CHEBI:24062] (288) 
 organofluorine compound [CHEBI:37143] (275) 
 ioflupane I(123) [CHEBI:68855] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organofluorine compound [CHEBI:37143] (275) 
 ioflupane I(123) [CHEBI:68855] (1)
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 ioflupane I(123) [CHEBI:68855] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 ioflupane I(123) [CHEBI:68855] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 ioflupane I(123) [CHEBI:68855] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 ioflupane I(123) [CHEBI:68855] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 ioflupane I(123) [CHEBI:68855] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 ioflupane I(123) [CHEBI:68855] (1)
 organohalogen compound [CHEBI:36684] (976) 
 organofluorine compound [CHEBI:37143] (275) 
 ioflupane I(123) [CHEBI:68855] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 ioflupane I(123) [CHEBI:68855] (1)
 ester [CHEBI:35701] (3370) 
 carboxylic ester [CHEBI:33308] (1495) 
 ioflupane I(123) [CHEBI:68855] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 ioflupane I(123) [CHEBI:68855] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 ioflupane I(123) [CHEBI:68855] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 ioflupane I(123) [CHEBI:68855] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 ioflupane I(123) [CHEBI:68855] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 ioflupane I(123) [CHEBI:68855] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 ioflupane I(123) [CHEBI:68855] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 ioflupane I(123) [CHEBI:68855] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 ioflupane I(123) [CHEBI:68855] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 ioflupane I(123) [CHEBI:68855] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 ioflupane I(123) [CHEBI:68855] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 ioflupane I(123) [CHEBI:68855] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 ioflupane I(123) [CHEBI:68855] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 ioflupane I(123) [CHEBI:68855] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 ioflupane I(123) [CHEBI:68855] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organofluorine compound [CHEBI:37143] (275) 
 ioflupane I(123) [CHEBI:68855] (1)
ChEBI Compound Accession Identifier  [CHEBI:68855]
ChEBI Compound Description  An azabicycloalkane that is ecgonine methyl ester in which the N-methyl group is replaced by 3-fluoropropyl and the 3beta-hydroxy group is replaced by 4-((123)I)iodophenyl. Used for the imaging of dopamine transporters in the brain of adult patients with potential Parkinsonian Syndromes.
ChEBI Compound Identification Number  68855
ChEBI InChI Value  InChI=1S/C18H23FINO2/c1-23-18(22)17-15(12-3-5-13(20)6-4-12)11-14-7-8-16(17)21(14)10-2-9-19/h3-6,14-17H,2,7-11H2,1H3/t14-,15+,16+,17-/m0/s1/i20-4
ChEBI InChIKey Value  HXWLAJVUJSVENX-HFIFKADTSA-N
ChEBI Compound Name  ioflupane I(123)
ChEBI SMILES Value  [H][C@]12CC[C@]([H])([C@H]([C@H](C1)c1ccc([123I])cc1)C(=O)OC)N2CCCF
ChEBI Substance ID  160645942
ChEBI URL  ChEBI:68855
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  HXWLAJVUJSVENX_HFIFKADTSA_N_000_000000
PubChem Compound ID  3086674