New Search

Item 8 of 10 (back to results)
Previous previous next Next

metoclopramide
Metoclopramide is a carboxamide resulting from the formal condensation of 4-amino-5-chloro-2-methoxybenzoic acid with the primary amino group of N,N-diethylethane-1,2-diamine.


Current search:

03. Biological Effects of Specific Chemicals: pharmacological uses [CHEBI:52210] > neurotransmitter agent [CHEBI:35942]
×
05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > gastrointestinal drug [CHEBI:55324]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 pharmacological uses [CHEBI:52210] (736) 
 neurotransmitter agent [CHEBI:35942] (471) 
 dopaminergic agent [CHEBI:48560] (99) 
 dopaminergic antagonist [CHEBI:48561] (48) 
 metoclopramide [CHEBI:107736] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antiemetic [CHEBI:50919] (41) 
 metoclopramide [CHEBI:107736] (1)
 gastrointestinal drug [CHEBI:55324] (24) 
 metoclopramide [CHEBI:107736] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 chlorine molecular entity [CHEBI:23117] (884) 
 organochlorine compound [CHEBI:36683] (543) 
 metoclopramide [CHEBI:107736] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 metoclopramide [CHEBI:107736] (1)
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 carboxamide [CHEBI:37622] (1381) 
 metoclopramide [CHEBI:107736] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 metoclopramide [CHEBI:107736] (1)
 organic amino compound [CHEBI:50047] (2472) 
 aromatic amine [CHEBI:33860] (91) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 metoclopramide [CHEBI:107736] (1)
 tertiary amino compound [CHEBI:50996] (199) 
 metoclopramide [CHEBI:107736] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 metoclopramide [CHEBI:107736] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 metoclopramide [CHEBI:107736] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 metoclopramide [CHEBI:107736] (1)
 organic amino compound [CHEBI:50047] (2472) 
 aromatic amine [CHEBI:33860] (91) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 metoclopramide [CHEBI:107736] (1)
 tertiary amino compound [CHEBI:50996] (199) 
 metoclopramide [CHEBI:107736] (1)
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 metoclopramide [CHEBI:107736] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 metoclopramide [CHEBI:107736] (1)
 organic amino compound [CHEBI:50047] (2472) 
 aromatic amine [CHEBI:33860] (91) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 metoclopramide [CHEBI:107736] (1)
 tertiary amino compound [CHEBI:50996] (199) 
 metoclopramide [CHEBI:107736] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 metoclopramide [CHEBI:107736] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 metoclopramide [CHEBI:107736] (1)
 aromatic amine [CHEBI:33860] (91) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 metoclopramide [CHEBI:107736] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 homocyclic compound [CHEBI:33597] (1134) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 metoclopramide [CHEBI:107736] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 metoclopramide [CHEBI:107736] (1)
 aromatic amine [CHEBI:33860] (91) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 metoclopramide [CHEBI:107736] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 metoclopramide [CHEBI:107736] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 metoclopramide [CHEBI:107736] (1)
 aromatic amine [CHEBI:33860] (91) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 metoclopramide [CHEBI:107736] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 metoclopramide [CHEBI:107736] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 metoclopramide [CHEBI:107736] (1)
 aromatic amine [CHEBI:33860] (91) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 metoclopramide [CHEBI:107736] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 metoclopramide [CHEBI:107736] (1)
ChEBI Compound Accession Identifier  [CHEBI:107736]
ChEBI Compound Description  Metoclopramide is a carboxamide resulting from the formal condensation of 4-amino-5-chloro-2-methoxybenzoic acid with the primary amino group of N,N-diethylethane-1,2-diamine.
ChEBI Compound Identification Number  107736
ChEBI InChI Value  InChI=1S/C14H22ClN3O2/c1-4-18(5-2)7-6-17-14(19)10-8-11(15)12(16)9-13(10)20-3/h8-9H,4-7,16H2,1-3H3,(H,17,19)
ChEBI InChIKey Value  TTWJBBZEZQICBI-UHFFFAOYSA-N
ChEBI Compound Name  metoclopramide
ChEBI SMILES Value  CCN(CC)CCNC(=O)c1cc(Cl)c(N)cc1OC
ChEBI Substance ID  85313179
ChEBI URL  ChEBI:107736
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  TTWJBBZEZQICBI_UHFFFAOYSA_N_000_000000
PubChem Compound ID  4168