| more general categories    | 
information about this item | 
 | 
| 03. Biological Effects of Specific Chemicals  | 
  | 
  | 
 
 
 
 
 | 
03. Biological Effects of Specific Chemicals | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 eplerenone [CHEBI:31547] (1) | 
 | 
  | 
| 05. Industrial Uses  | 
  | 
  | 
 
 
 
 
 | 
05. Industrial Uses | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 eplerenone [CHEBI:31547] (1) | 
 | 
  | 
| 08. Chemical Category  | 
  | 
  | 
 
 
 
 
 | 
08. Chemical Category | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 eplerenone [CHEBI:31547] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 eplerenone [CHEBI:31547] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 eplerenone [CHEBI:31547] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 eplerenone [CHEBI:31547] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 eplerenone [CHEBI:31547] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 eplerenone [CHEBI:31547] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 eplerenone [CHEBI:31547] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 eplerenone [CHEBI:31547] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 eplerenone [CHEBI:31547] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 eplerenone [CHEBI:31547] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 eplerenone [CHEBI:31547] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 eplerenone [CHEBI:31547] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 eplerenone [CHEBI:31547] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 eplerenone [CHEBI:31547] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 eplerenone [CHEBI:31547] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 eplerenone [CHEBI:31547] (1) | 
 | 
  | 
| ChEBI Compound Accession Identifier:  | 
 [CHEBI:31547] | 
| ChEBI Compound Description:  | 
 null | 
| ChEBI Compound Identification Number:  | 
 31547 | 
| ChEBI InChI Value:  | 
 InChI=1S/C24H30O6/c1-21-7-4-14(25)10-13(21)11-15(20(27)28-3)19-16-5-8-23(9-6-18(26)30-23)22(16,2)12-17-24(19,21)29-17/h10,15-17,19H,4-9,11-12H2,1-3H3/t15-,16+,17-,19+,21+,22+,23-,24-/m1/s1 | 
| ChEBI InChIKey Value:  | 
 JUKPWJGBANNWMW-VWBFHTRKSA-N | 
| ChEBI Compound Name:  | 
 eplerenone | 
| ChEBI SMILES Value:  | 
 [H][C@@]12CC[C@@]3(CCC(=O)O3)[C@@]1(C)C[C@H]1O[C@@]11[C@@]2([H])[C@@H](CC2=CC(=O)CC[C@]12C)C(=O)OC | 
| ChEBI Substance ID:  | 
 56352903 | 
| ChEBI URL:  | 
 ChEBI:31547 | 
| ChemSpider ID:  | 
 10203511 | 
| Ontomatica Chemical Accession Key (OnChAKey):  | 
 JUKPWJGBANNWMW_VWBFHTRKSA_N_000_000000 | 
| PubChem Compound ID:  | 
 443872 |