Item 77 of 138 (back to results) previous next jaspamide O A cyclodepsipeptide isolated from Jaspis splendens. A derivative of jaspamide, it has been shown to exhibit cytotoxic and microfilament disruption activity.

Current search: 07. Part of Biological Source of Chemical: unspecified structure [PO:0000004] × 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] × 05. Industrial Uses: pharmaceutical [CHEBI:52217] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   jaspamide O [CHEBI:66117] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   jaspamide O [CHEBI:66117] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Animalia (46)   Porifera (33)   Demospongiae (33)   Astrophorida (30)   Ancorinidae (30)   Jaspis (25)   Jaspis splendens (25) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  unspecified structure [PO:0000004] (703) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   depsipeptide [CHEBI:23643] (64)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   depsipeptide [CHEBI:23643] (64)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  organic amino compound [CHEBI:50047] (2472)   peptide [CHEBI:16670] (730)   depsipeptide [CHEBI:23643] (64)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   jaspamide O [CHEBI:66117] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   depsipeptide [CHEBI:23643] (64)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   depsipeptide [CHEBI:23643] (64)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   depsipeptide [CHEBI:23643] (64)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  organic amino compound [CHEBI:50047] (2472)   peptide [CHEBI:16670] (730)   depsipeptide [CHEBI:23643] (64)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   jaspamide O [CHEBI:66117] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   depsipeptide [CHEBI:23643] (64)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  ester [CHEBI:35701] (3370)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  organic amino compound [CHEBI:50047] (2472)   peptide [CHEBI:16670] (730)   depsipeptide [CHEBI:23643] (64)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   jaspamide O [CHEBI:66117] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   jaspamide O [CHEBI:66117] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   jaspamide O [CHEBI:66117] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   jaspamide O [CHEBI:66117] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   jaspamide O [CHEBI:66117] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   jaspamide O [CHEBI:66117] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   jaspamide O [CHEBI:66117] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   jaspamide O [CHEBI:66117] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   jaspamide O [CHEBI:66117] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   jaspamide O [CHEBI:66117] (1)  macrocycle [CHEBI:51026] (234)   jaspamide O [CHEBI:66117] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1)  carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   jaspamide O [CHEBI:66117] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   jaspamide O [CHEBI:66117] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   jaspamide O [CHEBI:66117] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   jaspamide O [CHEBI:66117] (1) 09. Chemical Capabilities  09. Chemical Capabilities  inhibitor [CHEBI:35222] (39)   actin polymerisation inhibitor [CHEBI:70728] (10)   jaspamide O [CHEBI:66117] (1) ChEBI Compound Accession Identifier:   [CHEBI:66117] ChEBI Compound Description:   A cyclodepsipeptide isolated from Jaspis splendens. A derivative of jaspamide, it has been shown to exhibit cytotoxic and microfilament disruption activity. ChEBI Compound Identification Number:   66117 ChEBI InChI Value:   InChI=1S/C35H46N4O7/c1-20-15-21(2)17-23(4)46-32(42)18-29(25-11-13-26(40)14-12-25)38-34(44)30(19-31(41)27-9-7-8-10-28(27)36)39(6)35(45)24(5)37-33(43)22(3)16-20/h7-15,21-24,29-30,40H,16-19,36H2,1-6H3,(H,37,43)(H,38,44)/b20-15+/t21-,22-,23-,24-,29+,30+/m0/s1 ChEBI InChIKey Value:   BPHLRINTBGJQFP-BEZABZTFSA-N ChEBI Compound Name:   jaspamide O ChEBI SMILES Value:   C[C@H]1C[C@@H](C)\C=C(C)\C[C@H](C)C(=O)N[C@@H](C)C(=O)N(C)[C@H](CC(=O)c2ccccc2N)C(=O)N[C@H](CC(=O)O1)c1ccc(O)cc1 ChEBI Substance ID:   160710201 ChEBI URL:   ChEBI:66117 ChemSpider ID:   27023946 Ontomatica Chemical Accession Key (OnChAKey):   BPHLRINTBGJQFP_BEZABZTFSA_N_000_000000 PubChem Compound ID:   25181189