New Search

Item 9 of 11 (back to results)
Previous previous next Next

ATTO 610-7
null


Current search:

Select any link to see items in a related category.

more general categories    information about this item
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 sulfur molecular entity [CHEBI:26835] (1541) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thiabicycloalkane [CHEBI:38297] (11) 
 ATTO 610-7 [CHEBI:51828] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thiabicycloalkane [CHEBI:38297] (11) 
 ATTO 610-7 [CHEBI:51828] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thiabicycloalkane [CHEBI:38297] (11) 
 ATTO 610-7 [CHEBI:51828] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thiabicycloalkane [CHEBI:38297] (11) 
 ATTO 610-7 [CHEBI:51828] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thiabicycloalkane [CHEBI:38297] (11) 
 ATTO 610-7 [CHEBI:51828] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thiabicycloalkane [CHEBI:38297] (11) 
 ATTO 610-7 [CHEBI:51828] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thiabicycloalkane [CHEBI:38297] (11) 
 ATTO 610-7 [CHEBI:51828] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thiabicycloalkane [CHEBI:38297] (11) 
 ATTO 610-7 [CHEBI:51828] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thiabicycloalkane [CHEBI:38297] (11) 
 ATTO 610-7 [CHEBI:51828] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thiabicycloalkane [CHEBI:38297] (11) 
 ATTO 610-7 [CHEBI:51828] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thiabicycloalkane [CHEBI:38297] (11) 
 ATTO 610-7 [CHEBI:51828] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thiabicycloalkane [CHEBI:38297] (11) 
 ATTO 610-7 [CHEBI:51828] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thiabicycloalkane [CHEBI:38297] (11) 
 ATTO 610-7 [CHEBI:51828] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thiabicycloalkane [CHEBI:38297] (11) 
 ATTO 610-7 [CHEBI:51828] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thiabicycloalkane [CHEBI:38297] (11) 
 ATTO 610-7 [CHEBI:51828] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thiabicycloalkane [CHEBI:38297] (11) 
 ATTO 610-7 [CHEBI:51828] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 thiabicycloalkane [CHEBI:38297] (11) 
 ATTO 610-7 [CHEBI:51828] (1)
ChEBI Compound Accession Identifier  [CHEBI:51828]
ChEBI Compound Description  null
ChEBI Compound Identification Number  51828
ChEBI InChI Value  "InChI=1S/C40H56N6O3S.ClHO4/c1-40(2)31-24-30(45(3)4)17-16-27(31)22-29-23-28-12-10-20-46(34(28)25-32(29)40)21-11-15-37(48)42-19-9-5-8-18-41-36(47)14-7-6-13-35-38-33(26-50-35)43-39(49)44-38;2-1(3,4)5/h16-17,22-25,33,35,38H,5-15,18-21,26H2,1-4H3,(H3-,41,42,43,44,47,48,49);(H,2,3,4,5)"
ChEBI InChIKey Value  NASQJISZQAKPTC-UHFFFAOYSA-N
ChEBI Compound Name  ATTO 610-7
ChEBI SMILES Value  [O-]Cl(=O)(=O)=O.CN(C)c1ccc2C=c3cc4CCC[N+](CCCC(=O)NCCCCCNC(=O)CCCCC5SCC6NC(=O)NC56)=c4cc3C(C)(C)c2c1
ChEBI Substance ID  57269737
ChEBI URL  ChEBI:51828
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  NASQJISZQAKPTC_UHFFFAOYSA_N_000_000000
PubChem Compound ID  16212820