| more general categories | information about this item |  | 
| | 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |  |  |  |
 |
 | 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |  | 
|  |  |  | 
|  | Cattle, fat (61) |  | 
|  | Cattle, meat byproducts (57) |  | 
|  | Goat, fat (57) |  | 
|  | Goat, meat byproducts (55) |  | 
|  | Horse, fat (57) |  | 
|  | Horse, meat byproducts (55) |  | 
|  | Sheep, fat (57) |  | 
|  | Sheep, meat byproducts (55) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | Bean (edible-podded) (2) |  | 
|  | Bean (edible-podded) (2) |  | 
|  |  |  | 
|  | Bean, succulent (18) |  | 
|  | Cultivars, Varieties, and/or Hybrids of Crop Group 08-10 : Fruiting Vegetable Group (34) |  | 
|  |  |  | 
|  | Okra (17) |  | 
|  |  |  | 
|  | Okra (17) |  | 
|  |  |  | 
|  | Cultivars, Varieties, and/or Hybrids of Crop Group 09 Subgroup 9A : Melon subgroup (5) |  | 
|  |  |  | 
|  | Cucumber (12) |  | 
|  | Cultivars, Varieties, and/or Hybrids of Crop Group 10 : Citrus Fruit Group (22) |  | 
|  | Cultivars, Varieties, and/or Hybrids of Crop Group 10-10 : Citrus Fruit Group (25) |  | 
|  | Cultivars, Varieties, and/or Hybrids of Crop Group 11 : Pome Fruits Group (26) |  | 
|  | Apple (37) |  | 
|  | Apple (37) |  | 
|  |  |  | 
|  | Apple (37) |  | 
|  | Apple (37) |  | 
|  |  |  | 
|  | Cherry, sweet (11) |  | 
|  | Cherry, tart (11) |  | 
|  | Cherry, sweet (11) |  | 
|  | Cherry, tart (11) |  | 
|  |  |  | 
|  |  |  | 
|  | Cherry, sweet (11) |  | 
|  | Cherry, tart (11) |  | 
|  | Cherry, sweet (11) |  | 
|  | Cherry, tart (11) |  | 
|  |  |  | 
|  | Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07A : Caneberry subgroup (12) |  | 
|  | Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07F : Small fruit vine climbing (except fuzzy kiwifruit) subgroup (9) |  | 
|  | Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07G : Low growing berry subgroup (13) |  | 
|  | Cultivars, Varieties, and/or Hybrids of Crop Group 14 : Tree Nuts Group (28) |  | 
|  | Almond (46) |  | 
|  | Almond (46) |  | 
|  |  |  | 
|  | Almond (46) |  | 
|  | Almond (46) |  | 
|  | Pistachio (28) |  | 
|  |  |  | 
|  |  |  | 
|  | Cowpea, forage (5) |  | 
|  | Cowpea, hay (6) |  | 
|  | 
| | 03. Biological Effects of Specific Chemicals |  |  |  |
 |
 | 03. Biological Effects of Specific Chemicals |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | acequinocyl [CHEBI:38592] (1) |  | 
|  | 
| | 05. Industrial Uses |  |  |  |
 |
 | 05. Industrial Uses |  | 
|  |  |  | 
|  | acequinocyl [CHEBI:38592] (1) |  | 
|  | 
| | 08. Chemical Category |  |  |  |
 |
 | 08. Chemical Category |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | acequinocyl [CHEBI:38592] (1) |  | 
|  |  |  | 
|  | acequinocyl [CHEBI:38592] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | acequinocyl [CHEBI:38592] (1) |  | 
|  |  |  | 
|  | acequinocyl [CHEBI:38592] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | acequinocyl [CHEBI:38592] (1) |  | 
|  |  |  | 
|  | acequinocyl [CHEBI:38592] (1) |  | 
|  |  |  | 
|  |  |  | 
|  | acequinocyl [CHEBI:38592] (1) |  | 
|  |  |  | 
|  | acequinocyl [CHEBI:38592] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | acequinocyl [CHEBI:38592] (1) |  | 
|  |  |  | 
|  | acequinocyl [CHEBI:38592] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | acequinocyl [CHEBI:38592] (1) |  | 
|  |  |  | 
|  | acequinocyl [CHEBI:38592] (1) |  | 
|  | 
| ChEBI Compound Accession Identifier: | [CHEBI:38592] | 
| ChEBI Compound Description: | An acetate ester consisting of 1,4-naphthoquinone bearing acetoxy and dodecyl substituents at positions 2 and 3 respectively. | 
| ChEBI Compound Identification Number: | 38592 | 
| ChEBI InChI Value: | InChI=1S/C24H32O4/c1-3-4-5-6-7-8-9-10-11-12-17-21-22(26)19-15-13-14-16-20(19)23(27)24(21)28-18(2)25/h13-16H,3-12,17H2,1-2H3 | 
| ChEBI InChIKey Value: | QDRXWCAVUNHOGA-UHFFFAOYSA-N | 
| ChEBI Compound Name: | acequinocyl | 
| ChEBI SMILES Value: | CCCCCCCCCCCCC1=C(OC(C)=O)C(=O)c2ccccc2C1=O | 
| ChEBI Substance ID: | 24775808 | 
| ChEBI URL: | ChEBI:38592 | 
| ChemSpider ID: | 84245 | 
| Ontomatica Chemical Accession Key (OnChAKey): | QDRXWCAVUNHOGA_UHFFFAOYSA_N_000_000000 | 
| PubChem Compound ID: | 93315 |