New Search

Item 10 of 10 (back to results)
Previous previous

almotriptan
An indole compound having a 2-(dimethylamino)ethyl group at the 3-position and a (pyrrolidin-1-ylsulfonyl)methyl group at the 5-position.


Current search:

03. Biological Effects of Specific Chemicals: pharmacological uses [CHEBI:52210] > neurotransmitter agent [CHEBI:35942]
×
05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > anti-inflammatory drug [CHEBI:35472]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 pharmacological uses [CHEBI:52210] (736) 
 neurotransmitter agent [CHEBI:35942] (471) 
 serotonergic drug [CHEBI:48278] (109) 
 serotonergic agonist [CHEBI:35941] (41) 
 almotriptan [CHEBI:520985] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 anti-inflammatory drug [CHEBI:35472] (112) 
 non-steroidal anti-inflammatory drug [CHEBI:35475] (71) 
 almotriptan [CHEBI:520985] (1)
 cardiovascular drug [CHEBI:35554] (162) 
 vasoconstrictor agent [CHEBI:50514] (29) 
 almotriptan [CHEBI:520985] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 sulfonamide [CHEBI:35358] (106) 
 almotriptan [CHEBI:520985] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amine [CHEBI:32952] (179) 
 tertiary amine [CHEBI:32876] (84) 
 almotriptan [CHEBI:520985] (1)
 tertiary amino compound [CHEBI:50996] (199) 
 tertiary amine [CHEBI:32876] (84) 
 almotriptan [CHEBI:520985] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 sulfur molecular entity [CHEBI:26835] (1541) 
 sulfur oxoacid derivative [CHEBI:33424] (628) 
 sulfonic acid derivative [CHEBI:33552] (393) 
 sulfonamide [CHEBI:35358] (106) 
 almotriptan [CHEBI:520985] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amine [CHEBI:32952] (179) 
 tertiary amine [CHEBI:32876] (84) 
 almotriptan [CHEBI:520985] (1)
 tertiary amino compound [CHEBI:50996] (199) 
 tertiary amine [CHEBI:32876] (84) 
 almotriptan [CHEBI:520985] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amine [CHEBI:32952] (179) 
 tertiary amine [CHEBI:32876] (84) 
 almotriptan [CHEBI:520985] (1)
 tertiary amino compound [CHEBI:50996] (199) 
 tertiary amine [CHEBI:32876] (84) 
 almotriptan [CHEBI:520985] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 almotriptan [CHEBI:520985] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 oxoacid derivative [CHEBI:33241] (3254) 
 sulfur oxoacid derivative [CHEBI:33424] (628) 
 sulfonic acid derivative [CHEBI:33552] (393) 
 sulfonamide [CHEBI:35358] (106) 
 almotriptan [CHEBI:520985] (1)
ChEBI Compound Accession Identifier  [CHEBI:520985]
ChEBI Compound Description  An indole compound having a 2-(dimethylamino)ethyl group at the 3-position and a (pyrrolidin-1-ylsulfonyl)methyl group at the 5-position.
ChEBI Compound Identification Number  520985
ChEBI InChI Value  InChI=1S/C17H25N3O2S/c1-19(2)10-7-15-12-18-17-6-5-14(11-16(15)17)13-23(21,22)20-8-3-4-9-20/h5-6,11-12,18H,3-4,7-10,13H2,1-2H3
ChEBI InChIKey Value  WKEMJKQOLOHJLZ-UHFFFAOYSA-N
ChEBI Compound Name  almotriptan
ChEBI SMILES Value  CN(C)CCc1c[nH]c2ccc(CS(=O)(=O)N3CCCC3)cc12
ChEBI Substance ID  85709739
ChEBI URL  ChEBI:520985
ChemSpider ID  110198
Ontomatica Chemical Accession Key (OnChAKey)  WKEMJKQOLOHJLZ_UHFFFAOYSA_N_000_000000
PubChem Compound ID  123606