Item 10 of 79 (back to results) previous next quillaic acid A pentacyclic triterpenoid that is olean-12-ene substituted by hydroxy groups at positions 3 and 16, an oxo group at position 23 and a carboxy group at position 28 (the 3beta,16alpha stereoisomer).

Current search: 05. Industrial Uses: anti-inflammatory agent [CHEBI:67079] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   quillaic acid [CHEBI:8710] (1) 05. Industrial Uses  05. Industrial Uses  anti-inflammatory agent [CHEBI:67079] (79)   quillaic acid [CHEBI:8710] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  carbonyl compound [CHEBI:36586] (5928)   aldehyde [CHEBI:17478] (258)   quillaic acid [CHEBI:8710] (1)  carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  carbonyl compound [CHEBI:36586] (5928)   aldehyde [CHEBI:17478] (258)   quillaic acid [CHEBI:8710] (1)  carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   lipid [CHEBI:18059] (3532)   isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   triterpenoid [CHEBI:36615] (228)   pentacyclic triterpenoid [CHEBI:25872] (112)   quillaic acid [CHEBI:8710] (1)  isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   triterpenoid [CHEBI:36615] (228)   pentacyclic triterpenoid [CHEBI:25872] (112)   quillaic acid [CHEBI:8710] (1)  heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  carbonyl compound [CHEBI:36586] (5928)   aldehyde [CHEBI:17478] (258)   quillaic acid [CHEBI:8710] (1)  carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic polycyclic compound [CHEBI:51958] (1654)   pentacyclic triterpenoid [CHEBI:25872] (112)   quillaic acid [CHEBI:8710] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   aldehyde [CHEBI:17478] (258)   quillaic acid [CHEBI:8710] (1)  carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   organic polycyclic compound [CHEBI:51958] (1654)   pentacyclic triterpenoid [CHEBI:25872] (112)   quillaic acid [CHEBI:8710] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic polycyclic compound [CHEBI:51958] (1654)   pentacyclic triterpenoid [CHEBI:25872] (112)   quillaic acid [CHEBI:8710] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic polycyclic compound [CHEBI:51958] (1654)   pentacyclic triterpenoid [CHEBI:25872] (112)   quillaic acid [CHEBI:8710] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   aldehyde [CHEBI:17478] (258)   quillaic acid [CHEBI:8710] (1)  carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   quillaic acid [CHEBI:8710] (1) ChEBI Compound Accession Identifier:   [CHEBI:8710] ChEBI Compound Description:   A pentacyclic triterpenoid that is olean-12-ene substituted by hydroxy groups at positions 3 and 16, an oxo group at position 23 and a carboxy group at position 28 (the 3beta,16alpha stereoisomer). ChEBI Compound Identification Number:   8710 ChEBI InChI Value:   InChI=1S/C30H46O5/c1-25(2)13-14-30(24(34)35)19(15-25)18-7-8-21-26(3)11-10-22(32)27(4,17-31)20(26)9-12-28(21,5)29(18,6)16-23(30)33/h7,17,19-23,32-33H,8-16H2,1-6H3,(H,34,35)/t19-,20+,21+,22-,23+,26-,27-,28+,29+,30+/m0/s1 ChEBI InChIKey Value:   MQUFAARYGOUYEV-UAWZMHPWSA-N ChEBI Compound Name:   quillaic acid ChEBI SMILES Value:   [H][C@@]12CC(C)(C)CC[C@@]1([C@H](O)C[C@]1(C)C2=CC[C@]2([H])[C@@]3(C)CC[C@H](O)[C@@](C)(C=O)[C@]3([H])CC[C@@]12C)C(O)=O ChEBI Substance ID:   160962748 ChEBI URL:   ChEBI:8710 ChemSpider ID:   91986 Ontomatica Chemical Accession Key (OnChAKey):   MQUFAARYGOUYEV_UAWZMHPWSA_N_000_000000 PubChem Compound ID:   101810