Item 92 of 114 (back to results) previous next norfentanyl A carboxamide resulting from the formal condensation of the aryl amino group of 4-(N'-phenyl)piperidin-4-amine with propanoic acid. A major metabolite of fentanyl.

Current search: 03. Biological Effects of Specific Chemicals: pharmacological uses [CHEBI:52210] > analgesic [CHEBI:35480] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   norfentanyl [CHEBI:62685] (1)  pharmacological uses [CHEBI:52210] (736)   analgesic [CHEBI:35480] (114)   opioid analgesic [CHEBI:35482] (40)   norfentanyl [CHEBI:62685] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   anilide [CHEBI:13248] (11)   norfentanyl [CHEBI:62685] (1)  primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   norfentanyl [CHEBI:62685] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   norfentanyl [CHEBI:62685] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   norfentanyl [CHEBI:62685] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   norfentanyl [CHEBI:62685] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   norfentanyl [CHEBI:62685] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   norfentanyl [CHEBI:62685] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   norfentanyl [CHEBI:62685] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   norfentanyl [CHEBI:62685] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   norfentanyl [CHEBI:62685] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   norfentanyl [CHEBI:62685] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   norfentanyl [CHEBI:62685] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   norfentanyl [CHEBI:62685] (1)  carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilide [CHEBI:13248] (11)   norfentanyl [CHEBI:62685] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilide [CHEBI:13248] (11)   norfentanyl [CHEBI:62685] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilide [CHEBI:13248] (11)   norfentanyl [CHEBI:62685] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilide [CHEBI:13248] (11)   norfentanyl [CHEBI:62685] (1)  monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   norfentanyl [CHEBI:62685] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   norfentanyl [CHEBI:62685] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   norfentanyl [CHEBI:62685] (1)  carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilide [CHEBI:13248] (11)   norfentanyl [CHEBI:62685] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilide [CHEBI:13248] (11)   norfentanyl [CHEBI:62685] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   norfentanyl [CHEBI:62685] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   norfentanyl [CHEBI:62685] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   norfentanyl [CHEBI:62685] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   norfentanyl [CHEBI:62685] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   norfentanyl [CHEBI:62685] (1)  carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilide [CHEBI:13248] (11)   norfentanyl [CHEBI:62685] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilide [CHEBI:13248] (11)   norfentanyl [CHEBI:62685] (1) ChEBI Compound Accession Identifier:   [CHEBI:62685] ChEBI Compound Description:   A carboxamide resulting from the formal condensation of the aryl amino group of 4-(N'-phenyl)piperidin-4-amine with propanoic acid. A major metabolite of fentanyl. ChEBI Compound Identification Number:   62685 ChEBI InChI Value:   InChI=1S/C14H20N2O/c1-2-14(17)16(12-6-4-3-5-7-12)13-8-10-15-11-9-13/h3-7,13,15H,2,8-11H2,1H3 ChEBI InChIKey Value:   PMCBDBWCQQBSRJ-UHFFFAOYSA-N ChEBI Compound Name:   norfentanyl ChEBI SMILES Value:   CCC(=O)N(C1CCNCC1)c1ccccc1 ChEBI Substance ID:   125258741 ChEBI URL:   ChEBI:62685 ChemSpider ID:   227671 Ontomatica Chemical Accession Key (OnChAKey):   PMCBDBWCQQBSRJ_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   259381