| more general categories |
information about this item |
|
| 06. Name of Biological Source of Chemical |
 |
 |
|
06. Name of Biological Source of Chemical |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Stemona phyllantha (5) |
|
|
|
Stemona tuberosa (5) |
|
 |
| 07. Part of Biological Source of Chemical |
 |
 |
|
07. Part of Biological Source of Chemical |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
tuberous root [PO:0025476] (13) |
|
|
|
rhizome [PO:0004542] (88) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
tuberostemonine [CHEBI:69383] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:69383] |
| ChEBI Compound Description: |
null |
| ChEBI Compound Identification Number: |
69383 |
| ChEBI InChI Value: |
InChI=1S/C22H33NO4/c1-4-13-14-7-5-6-8-23-16(17-9-11(2)21(24)26-17)10-15(19(14)23)18-12(3)22(25)27-20(13)18/h11-20H,4-10H2,1-3H3/t11-,12-,13+,14+,15+,16-,17-,18+,19+,20-/m0/s1 |
| ChEBI InChIKey Value: |
GYOGHROCTSEKDY-JJDZUBOLSA-N |
| ChEBI Compound Name: |
tuberostemonine |
| ChEBI SMILES Value: |
[H][C@]1(C[C@H](C)C(=O)O1)[C@]1([H])C[C@]2([H])[C@@]3([H])[C@H](C)C(=O)O[C@@]3([H])[C@H](CC)[C@@]3([H])CCCCN1[C@@]23[H] |
| ChEBI Substance ID: |
160711810 |
| ChEBI URL: |
ChEBI:69383 |
| ChemSpider ID: |
91061 |
| Ontomatica Chemical Accession Key (OnChAKey): |
GYOGHROCTSEKDY_JJDZUBOLSA_N_000_000000 |
| PubChem Compound ID: |
100781 |