| more general categories |
information about this item |
|
| 06. Name of Biological Source of Chemical |
 |
 |
|
06. Name of Biological Source of Chemical |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Cornus walteri (14) |
|
 |
| 07. Part of Biological Source of Chemical |
 |
 |
|
07. Part of Biological Source of Chemical |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
stem epidermis [PO:0025178] (134) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
stem [PO:0009047] (170) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Cornusalterin F [CHEBI:70114] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:70114] |
| ChEBI Compound Description: |
null |
| ChEBI Compound Identification Number: |
70114 |
| ChEBI InChI Value: |
InChI=1S/C30H48O/c1-20(2)10-9-11-21(3)22-14-18-29(7)23-12-13-25-27(4,5)17-16-26(31)30(25,8)24(23)15-19-28(22,29)6/h12,16-17,20-22,24-25H,9-11,13-15,18-19H2,1-8H3/t21-,22-,24-,25-,28-,29+,30+/m0/s1 |
| ChEBI InChIKey Value: |
SRZGQWOHBSWCAT-RIZYFFEQSA-N |
| ChEBI Compound Name: |
Cornusalterin F |
| ChEBI SMILES Value: |
[H][C@]1(CC[C@]2(C)C3=CC[C@@]4([H])C(C)(C)C=CC(=O)[C@]4(C)[C@@]3([H])CC[C@@]12C)[C@@H](C)CCCC(C)C |
| ChEBI Substance ID: |
160713106 |
| ChEBI URL: |
ChEBI:70114 |
| ChemSpider ID: |
NS |
| Ontomatica Chemical Accession Key (OnChAKey): |
SRZGQWOHBSWCAT_RIZYFFEQSA_N_000_000000 |
| PubChem Compound ID: |
50994305 |